|
|
| | 1,3,5-TRIVINYL-1,3,5-TRIMETHYLCYCLOTRISILAZANE Basic information |
| Product Name: | 1,3,5-TRIVINYL-1,3,5-TRIMETHYLCYCLOTRISILAZANE | | Synonyms: | 1,3,5-TRIMETHYL-1,3,5-TRIVINYLCYCLOTRISILAZANE;1,3,5-TRIVINYL-1,3,5-TRIMETHYLCYCLOTRISILAZANE;2,4,6-TRIMETHYL-2,4,6-TRIVINYLCYCLOTRISILAZANE;1,3,5-TRIVINYL-1,3,5-TRIMETHYLCYCLOTRISILAZANE 95%;2,4,6-Triethenyl-2,4,6-trimethylcyclohexanetrisilazane;2,4,6-Trimethyl-2,4,6-trivinyl-1,3,5-triaza-2,4,6-trisilacyclohexane;2,4,6-Trimethyl-2,4,6-trivinylcyclohexanetrisilazane;Cyclotrisilazane, 2,4,6-triethenyl-2,4,6-trimethyl- | | CAS: | 5505-72-6 | | MF: | C9H21N3Si3 | | MW: | 255.54 | | EINECS: | 226-848-3 | | Product Categories: | Chemical Synthesis;Organometallic Reagents;Organosilicon;Silazanes | | Mol File: | 5505-72-6.mol |  |
| | 1,3,5-TRIVINYL-1,3,5-TRIMETHYLCYCLOTRISILAZANE Chemical Properties |
| Boiling point | 106 °C | | density | 0.964 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.482 | | Fp | 85°C | | pka | 11.79±0.20(Predicted) | | form | clear liquid | | Specific Gravity | 0.939 | | color | Colorless to Light yellow to Light orange | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | BRN | 2055568 | | InChI | 1S/C9H21N3Si3/c1-7-13(4)10-14(5,8-2)12-15(6,9-3)11-13/h7-12H,1-3H2,4-6H3 | | InChIKey | RFSBGZWBVNPVNN-UHFFFAOYSA-N | | SMILES | C[Si]1(N[Si](C)(N[Si](C)(N1)C=C)C=C)C=C |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3267 8/PG 3 | | WGK Germany | 3 | | F | 10-21 | | TSCA | No | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29012990 | | Storage Class | 10 - Combustible liquids |
| | 1,3,5-TRIVINYL-1,3,5-TRIMETHYLCYCLOTRISILAZANE Usage And Synthesis |
| | 1,3,5-TRIVINYL-1,3,5-TRIMETHYLCYCLOTRISILAZANE Preparation Products And Raw materials |
|