|
|
| | 2,2,4,4,6,6-Hexamethylcyclotrisilazane Basic information |
| Product Name: | 2,2,4,4,6,6-Hexamethylcyclotrisilazane | | Synonyms: | Cyclotrisilazane, 2,2,4,4,6,6-hexamethyl-;Cyclotrisilazane, hexamethyl-;cyclotrisilazane,2,2,4,4,6,6-hexamethyl-;Dimethylsilazane trimer;dimethylsilazanetrimer;H7250;nsc139842;2,2,4,4,6,6-Hexamethy | | CAS: | 1009-93-4 | | MF: | C6H21N3Si3 | | MW: | 219.51 | | EINECS: | 213-773-6 | | Product Categories: | Si (Classes of Silicon Compounds);Silazanes;Si-N Compounds;Organometallic Reagents;Organosilicon | | Mol File: | 1009-93-4.mol |  |
| | 2,2,4,4,6,6-Hexamethylcyclotrisilazane Chemical Properties |
| Melting point | −10 °C(lit.) | | Boiling point | 188 °C756 mm Hg(lit.) | | density | 0.92 g/mL at 25 °C(lit.) | | vapor pressure | 35Pa at 25℃ | | refractive index | n20/D 1.445(lit.) | | Fp | 139 °F | | storage temp. | 2-8°C, protect from light | | Water Solubility | Decomposes in contact with water,Insoluble in water | | pka | 14.76±0.20(Predicted) | | form | liquid | | color | colorless | | Specific Gravity | 0.922 | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | BRN | 774739 | | InChI | 1S/C6H21N3Si3/c1-10(2)7-11(3,4)9-12(5,6)8-10/h7-9H,1-6H3 | | InChIKey | WGGNJZRNHUJNEM-UHFFFAOYSA-N | | SMILES | C[Si]1(C)N[Si](C)(C)N[Si](C)(C)N1 | | CAS DataBase Reference | 1009-93-4(CAS DataBase Reference) | | NIST Chemistry Reference | Hexamethylcyclotrisilazane(1009-93-4) | | EPA Substance Registry System | Cyclotrisilazane, 2,2,4,4,6,6-hexamethyl- (1009-93-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | 1993 | | WGK Germany | 3 | | RTECS | GZ4720000 | | F | 10-21 | | TSCA | TSCA listed | | HazardClass | 3.2 | | PackingGroup | III | | HS Code | 29349990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| | 2,2,4,4,6,6-Hexamethylcyclotrisilazane Usage And Synthesis |
| Description | 2,2,4,4,6,6-Hexamethylcyclotrisilazane is a colorless liquid that is soluble in water. It has an odor similar to ether and a boiling point of about 100 degrees Celsius. The chemical formula for this compound is CH3(CH2)6SiCl6. 2,2,4,4,6,6-Hexamethylcyclotrisilazane has been used as a solvent for producing polymers and as a reagent for organic synthesis. It may also be used as a precursor to silicon dioxide nanoparticles used in producing semiconductors and solar cells. 2,2,4,4,6,6-Hexamethylcyclotrisilazane reacts with hydrochloric acid to produce hydrogen chloride gas and zirconium oxide. It also reacts with sodium citrate in the presence of fatty acids to form an ester product called methyl eth.
| | Chemical Properties | clear colorless liquid | | Hazard | Moderately toxic by ingestion. | | Flammability and Explosibility | Flammable | | Purification Methods | Purify it by fractional distillation at atmospheric pressure until the temperature reaches 200o. It is moisture sensitive. The residue in the flask is mostly octamethylcyclotetrasilazane. [Brewer & Haber J Am Chem Soc 70 3888 1948, Beilstein 4 III 1887.] | | Toxics Screening Level | The ITSL for hexamethylcyclotrisilazane is 0.1 μg/m3 based on an annual averaging time. |
| | 2,2,4,4,6,6-Hexamethylcyclotrisilazane Preparation Products And Raw materials |
|