|
|
| | Benzenesulfonic acid monohydrate Basic information |
| | Benzenesulfonic acid monohydrate Chemical Properties |
| Melting point | 42-49 °C(lit.) | | Fp | 53 °C | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | powder to lump | | color | White to Gray to Red | | Water Solubility | transparency | | BRN | 4552655 | | InChI | InChI=1S/C6H6O3S.H2O/c7-10(8,9)6-4-2-1-3-5-6;/h1-5H,(H,7,8,9);1H2 | | InChIKey | MVIOINXPSFUJEN-UHFFFAOYSA-N | | SMILES | S(C1C=CC=CC=1)(O)(=O)=O.O |
| Hazard Codes | C | | Risk Statements | 20/21/22-34-22 | | Safety Statements | 26-27-36/37/39-45 | | RIDADR | UN 1803 | | WGK Germany | 3 | | RTECS | DB4200000 | | HS Code | 2904.10.3700 | | HazardClass | 8 | | PackingGroup | II | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Dam. 1
Skin Corr. 1B |
| | Benzenesulfonic acid monohydrate Usage And Synthesis |
| Uses | Benzenesulfonic Acid Monohydrate is used in the synthesis of HER2/EFGR dual inhibitors in the treatment of cancers and displaying potency towards anti-tumor activity. | | Uses | Benzenesulfonic acid monohydrate (PhSO3H. H2O) can be used as:
- A catalyst to synthesize α,β-unsaturated amides via Pd-catalyzed selective aminocarbonylation of styrenes with nitroarenes.
- A reactant to prepare amino acid benzyl ester salts for the study of gelation in nonpolar solvents.
- A catalyst for the conversion of oxydipropionitrile (nitrile) to di-n-propyl-oxydipropionate (ester).
|
| | Benzenesulfonic acid monohydrate Preparation Products And Raw materials |
|