|
|
| | 9-methoxycamptothecin Basic information |
| Product Name: | 9-methoxycamptothecin | | Synonyms: | (4S)-10-Methoxy-4α-ethyl-4β-hydroxy-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione;(4S)-4-Ethyl-4-hydroxy-10-methoxy-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione;(4S)-4α-Ethyl-4-hydroxy-10-methoxy-3,4,12,14-tetrahydro-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14-dione;Methoxycamptothecin, 9-;(4S)-4-Ethyl-4-hydroxy-10-methoxy-1H-pyrano[3',4';(S)-9-Methoxy Camptothecin;1H-Pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione, 4-ethyl-4-hydroxy-10-methoxy-, (4S)-;(S)-4-ethyl-4-hydroxy-10-methoxy-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione | | CAS: | 39026-92-1 | | MF: | C21H18N2O5 | | MW: | 378.38 | | EINECS: | | | Product Categories: | Alkaloids | | Mol File: | 39026-92-1.mol |  |
| | 9-methoxycamptothecin Chemical Properties |
| Melting point | 223-225℃ | | Boiling point | 773.1±60.0 °C(Predicted) | | density | 1.50±0.1 g/cm3 (20 ºC 760 Torr) | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | powder | | pka | 11.20±0.20(Predicted) | | color | Yellow | | InChI | InChI=1S/C21H18N2O5/c1-3-21(26)14-8-16-18-11(7-12-15(22-18)5-4-6-17(12)27-2)9-23(16)19(24)13(14)10-28-20(21)25/h4-8,26H,3,9-10H2,1-2H3/t21-/m0/s1 | | InChIKey | XVMZDZFTCKLZTF-NRFANRHFSA-N | | SMILES | N1C2C(=C(OC)C=CC=2)C=C2CN3C(C=12)=CC1[C@](CC)(O)C(=O)OCC=1C3=O |
| | 9-methoxycamptothecin Usage And Synthesis |
| Chemical Properties | Pale yellow crystalline powder, soluble in methanol, ethanol, DMSO and other organic solvents, from Mappia feotida Miers (Stinking Mappia), family Ironwoodaceae Stem Ervatamia heyneana (Wall.) T. Cook, family Oleaceae Sea wood dogwood. | | Uses | 9-Methoxycamptothecin is an alkaloid derivative of Camptothecin (C175150) derivative used in the treatment of cancers. Camptothecin is a potent anti-cancer agent. |
| | 9-methoxycamptothecin Preparation Products And Raw materials |
|