- 1H-INDOL-2-YLMETHANOL
-
- $1.00 / 1KG
-
2019-12-26
- CAS:24621-70-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200KG
|
| | 1H-INDOL-2-YLMETHANOL Basic information |
| | 1H-INDOL-2-YLMETHANOL Chemical Properties |
| Melting point | 72-78 °C | | Boiling point | 360.6±17.0 °C(Predicted) | | density | 1.272±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | solid | | pka | 14.86±0.10(Predicted) | | Appearance | Light brown to yellow Solid | | InChI | InChI=1S/C9H9NO/c11-6-8-5-7-3-1-2-4-9(7)10-8/h1-5,10-11H,6H2 | | InChIKey | XEEANGGQJOWRTG-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC=C2)C=C1CO |
| Hazard Codes | Xi | | Risk Statements | 41 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2933998090 |
| | 1H-INDOL-2-YLMETHANOL Usage And Synthesis |
| Uses | Reactant for the synthesis of:
- Oxazino[4,3-a]indoles
- 2-arylsulfonylmethyl-3-piperazinylmethylindole derivatives as 5-HT6 receptor ligands
- SR13668 designed to mimic the unique anticancer mechanisms of dietary indole-3-carbinol to block Akt signaling
- Azido- and isothiocyanato-substituted indoles as melatoninergic agents
|
| | 1H-INDOL-2-YLMETHANOL Preparation Products And Raw materials |
|