|
|
| | Isopropyl beta-D-thioglucopyranoside Basic information |
| Product Name: | Isopropyl beta-D-thioglucopyranoside | | Synonyms: | ISOPROPYL BETA-D-THIOGLUCOSIDE;IPTGLC;isopropyl B-D-thioglucopyranoside;isopropyl β-d-thioglucopyranoside;isopropyl β-d-thioglucoside;Isopropyl-β-D-thio-glucopyranosid;β-D-Glucopyranoside, 1-methylethyl 1-thio-;Isopropyl 1-thio-β-D-glucopyranoside | | CAS: | 19165-11-8 | | MF: | C9H18O5S | | MW: | 238.3 | | EINECS: | | | Product Categories: | Carbohydrates | | Mol File: | 19165-11-8.mol |  |
| | Isopropyl beta-D-thioglucopyranoside Chemical Properties |
| Boiling point | 438.4±45.0 °C(Predicted) | | density | 1.37±0.1 g/cm3(Predicted) | | storage temp. | −20°C | | pka | 13.00±0.70(Predicted) | | InChI | InChI=1/C9H18O5S/c1-4(2)15-9-8(13)7(12)6(11)5(3-10)14-9/h4-13H,3H2,1-2H3/t5-,6-,7+,8-,9+/s3 | | InChIKey | BPHPUYQFMNQIOC-QHXZDXPMNA-N | | SMILES | [C@H]1(SC(C)C)[C@H](O)[C@H]([C@H](O)[C@@H](CO)O1)O |&1:0,5,7,8,10,r| |
| | Isopropyl beta-D-thioglucopyranoside Usage And Synthesis |
| Uses | Isopropyl β-D-thioglucopyranoside is a biochemical reagent that can be used as a biological material or organic compound for life science related research. | | Definition | ChEBI: Isopropyl 1-thio-beta-D-glucopyranoside is a S-glycosyl compound. |
| | Isopropyl beta-D-thioglucopyranoside Preparation Products And Raw materials |
|