- CHLOROAC-PRO-OH
-
- $2.00
-
2019-07-06
- CAS:23500-10-9
- Min. Order: 1kg
- Purity: 99%
|
| | CHLOROAC-PRO-OH Basic information |
| Product Name: | CHLOROAC-PRO-OH | | Synonyms: | (S)-1-(2-Chloro-acetyl)-pyrrolidine-2-carboxylicacid,tech;1-(chloroacetyl)proline;Anagliptin Impurity 1;Vildagliptin Impurity 9/(S)-1-(2-Chloro-acetyl)-pyrrolidine-2-carboxylic acid;vildagliptin Impurity P;CHLOROACETYL-L-PROLINE;CHLOROAC-PRO-OH;CLAC-PRO-OH | | CAS: | 23500-10-9 | | MF: | C7H10ClNO3 | | MW: | 191.61 | | EINECS: | 245-695-3 | | Product Categories: | | | Mol File: | 23500-10-9.mol |  |
| | CHLOROAC-PRO-OH Chemical Properties |
| Melting point | 112-113 °C | | Boiling point | 399.0±37.0 °C(Predicted) | | density | 1.422±0.06 g/cm3(Predicted) | | pka | 3.27±0.20(Predicted) | | InChI | InChI=1S/C7H10ClNO3/c8-4-6(10)9-3-1-2-5(9)7(11)12/h5H,1-4H2,(H,11,12)/t5-/m0/s1 | | InChIKey | LXDUOIDIFSKLNB-YFKPBYRVSA-N | | SMILES | C(O)(=O)[C@@H]1CCCN1C(CCl)=O |
| HazardClass | IRRITANT | | HS Code | 2933998090 |
| | CHLOROAC-PRO-OH Usage And Synthesis |
| Uses | (S)-1-(2-Chloro-acetyl)-pyrrolidine-2-carboxylic Acid is used in preparation of vildagliptin impurity. |
| | CHLOROAC-PRO-OH Preparation Products And Raw materials |
|