|
|
| | 2,2'-IMINODIBENZOIC ACID Basic information |
| Product Name: | 2,2'-IMINODIBENZOIC ACID | | Synonyms: | 2,2’-dicarboxyldiphenylamine;2,2’-diphenylaminedicarboxylicacid;2,2’-iminodi-benzoicaci;n-(o-carboxyphenyl)-anthranilicaci;DIPHENYLAMINE-2,2'-DICARBOXYLIC ACID;2,2'-IMINODIBENZOIC ACID;N-Cinnamoyl-o-tolylhydrorylamine;Diphenylamine-2,2'-dicarboxyli | | CAS: | 579-92-0 | | MF: | C14H11NO4 | | MW: | 257.24 | | EINECS: | 200-258-5 | | Product Categories: | | | Mol File: | 579-92-0.mol |  |
| | 2,2'-IMINODIBENZOIC ACID Chemical Properties |
| Melting point | 298 °C (dec.)(lit.) | | Boiling point | 400.49°C (rough estimate) | | density | 1.2471 (rough estimate) | | refractive index | 1.5780 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 3.36±0.36(Predicted) | | Appearance | Light yellow to khaki Solid | | Merck | 13,3350 | | Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. | | InChI | 1S/C14H11NO4/c16-13(17)9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)14(18)19/h1-8,15H,(H,16,17)(H,18,19) | | InChIKey | ZFRNOTZQUGWMQN-UHFFFAOYSA-N | | SMILES | OC(=O)c1ccccc1Nc2ccccc2C(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | RTECS | DH2960000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2,2'-IMINODIBENZOIC ACID Usage And Synthesis |
| Chemical Properties | light yellow powder or crystals | | Uses | Instead of diphenylamine in reactions with oxidizing agents. 2,2'-iminodibenzoic acid may be used as an oxidation-reduction indicator in strongly acid solutions. | | Uses | 2,2''-Dicarboxydiphenylamine is used as a reagent in the synthesis of conjugates of muramyldipeptide or normuramyldipeptide with hydroxyacridine/acridone derivatives, used for antitumor activity. | | Purification Methods | Crystallise the acid from EtOH. It complexes with Cu2+ , Zn2+ , Cd2+, Co2+ and Ni2+ . [Beilstein 14 H 354, 14 I 545, 14 III 942, 14 IV 1058.] |
| | 2,2'-IMINODIBENZOIC ACID Preparation Products And Raw materials |
|