| Company Name: |
Alabiotech Inc. |
| Tel: |
001-619-354-5251 |
| Email: |
sales@alabiotech-e.com |
|
| | CALPAIN INHIBITOR XI Basic information |
| Product Name: | CALPAIN INHIBITOR XI | | Synonyms: | CALPAIN INHIBITOR XI;Z-L-ABU-CONH(CH2)3-MORPHOLINE;TZVQRMYLYQNBOA-UHFFFAOYSA-N;Carbamic acid, [1-[[[1-ethyl-3-[[3-(4-morpholinyl)propyl]amino]-2,3-dioxopropyl]amino]carbonyl]-3-methylbutyl]-, phenylmethyl ester (9CI) | | CAS: | 145731-49-3 | | MF: | C19H29N3O4 | | MW: | 363.45 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | CALPAIN INHIBITOR XI Chemical Properties |
| density | 1.145±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: 5mg/mL | | pka | 11.10±0.46(Predicted) | | form | Solid | | color | white to off-white | | Sensitive | Light Sensitive | | InChIKey | TZVQRMYLYQNBOA-UHFFFAOYSA-N | | SMILES | N2(CCOCC2)CCCNC(=O)C(=O)C(NC(=O)C(NC(=O)OCc1ccccc1)CC(C)C)CC |
| WGK Germany | WGK 1 | | Storage Class | 11 - Combustible Solids |
| | CALPAIN INHIBITOR XI Usage And Synthesis |
| Uses | A cell-permeable dipeptidyl -ketoamide that acts as a potent, highly selective, reversible, and active site inhibitor of calpain-1 and -2 | | Biological Activity | Cell permeable: yes', 'Primary Target
calpain 1, calpain 2', 'Product does not compete with ATP.', 'Reversible: yes', 'Target Ki: 140 nM and 41 nM, against calpain-1 and -2, respectively |
| | CALPAIN INHIBITOR XI Preparation Products And Raw materials |
|