|
|
| | (R)-2-(2-Oxo-pyrrolidin-1-yl)-butyramide Basic information |
| Product Name: | (R)-2-(2-Oxo-pyrrolidin-1-yl)-butyramide | | Synonyms: | 1-PYRROLIDINEACETAMIDE, A-ETHYL-2-OXO-, (AR)-;R-(+)-ETIRACETAM;UCB-L 060;(R)-alpha-Ethyl-2-oxo-1-pyrrolidineacetamide;1-Pyrrolidineacetamide, alpha-ethyl-2-oxo-, (R)-;R-(+)-LevetiracetaM;levetiraccetam R-isomer;Levetiracetam Impurity enantiomer | | CAS: | 103765-01-1 | | MF: | C8H14N2O2 | | MW: | 170.21 | | EINECS: | | | Product Categories: | | | Mol File: | 103765-01-1.mol |  |
| | (R)-2-(2-Oxo-pyrrolidin-1-yl)-butyramide Chemical Properties |
| Melting point | 114-116 °C(Solv: acetone (67-64-1)) | | Boiling point | 395.9±25.0 °C(Predicted) | | density | 1.168±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Acetone (Sparingly, Sonicated), Chloroform (Slightly), Methanol (Slightly) | | pka | 15.74±0.50(Predicted) | | color | White to Off-White | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C8H14N2O2/c1-2-6(8(9)12)10-5-3-4-7(10)11/h6H,2-5H2,1H3,(H2,9,12)/t6-/m1/s1 | | InChIKey | HPHUVLMMVZITSG-ZCFIWIBFSA-N | | SMILES | N1(CCCC1=O)[C@H](CC)C(=O)N |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Eye Irrit. 2 |
| | (R)-2-(2-Oxo-pyrrolidin-1-yl)-butyramide Usage And Synthesis |
| Uses | (R)-Levetiracetam [REV] (Levetiracetam EP Impurity D), is the enantiomer to Levetiracetam [LEV] (L331500), the antiepileptic drug that is highly enantioselective. It is apparent that [LEV] is more potent than [REV] in terms of antiepileptic potency. |
| | (R)-2-(2-Oxo-pyrrolidin-1-yl)-butyramide Preparation Products And Raw materials |
|