|
|
| | 2-AMINO-3-BROMO-5-CHLOROPYRAZINE Basic information |
| Product Name: | 2-AMINO-3-BROMO-5-CHLOROPYRAZINE | | Synonyms: | 3-Bromo-5-chloropyrazin-2-ylamine;Amino-3-bromo-5-chloropyrazine;2-AMINO-3-BROMO-5-CHLOROPYRAZINE;3-broMo-5-chloropyrazin-2-aMine;3-Bromo-5-chloro-2-aminopyrazine;2-Pyrazinamine, 3-bromo-5-chloro-;2-AMINO-3-BROMO-5-CHLOROPYRAZINE ISO 9001：2015 REACH;2-amine-3-bromo-5-chloropyrazin | | CAS: | 76537-18-3 | | MF: | C4H3BrClN3 | | MW: | 208.44 | | EINECS: | | | Product Categories: | | | Mol File: | 76537-18-3.mol |  |
| | 2-AMINO-3-BROMO-5-CHLOROPYRAZINE Chemical Properties |
| Boiling point | 298.4±35.0 °C(Predicted) | | density | 1.96 | | refractive index | 1.66 | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 0.89±0.10(Predicted) | | Appearance | Light yellow to brown Solid | | InChI | InChI=1S/C4H3BrClN3/c5-3-4(7)8-1-2(6)9-3/h1H,(H2,7,8) | | InChIKey | ACFBUXHJONGLLF-UHFFFAOYSA-N | | SMILES | C1(N)=NC=C(Cl)N=C1Br |
| | 2-AMINO-3-BROMO-5-CHLOROPYRAZINE Usage And Synthesis |
| Synthesis | General procedure for the synthesis of 2-amino-3-bromo-5-chloropyrazine from 2-amino-5-chloropyrazine: 2-amino-5-chloropyrazine (3 g, 23 mmol), N-bromosuccinimide (4 g, 23 mmol), and dichloromethane (100 mL) were added to a 250 mL round-bottomed flask under nitrogen protection. The reaction mixture was heated and refluxed for 1 h before being cooled to room temperature and concentrated under reduced pressure. The crude product was purified by fast column chromatography using pentane/ethyl acetate (0 to 50%) as eluent to afford 2-amino-3-bromo-5-chloropyrazine (3 g, 62% yield).1H NMR (DMSO-d6) δ 6.8-6.9 (2H, broad single peak), 8.0 (1H, single peak). Mass spectrum (ES+): m/z 210, 212. | | References | [1] Journal of Medicinal Chemistry, 1997, vol. 40, # 6, p. 996 - 1004
[2] Patent: WO2006/58074, 2006, A1. Location in patent: Page/Page column 20
[3] Patent: US5866568, 1999, A
[4] Patent: US5668137, 1997, A
[5] Patent: WO2018/98499, 2018, A1. Location in patent: Page/Page column 283 |
| | 2-AMINO-3-BROMO-5-CHLOROPYRAZINE Preparation Products And Raw materials |
|