| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 4-Amino-5-bromo-6-chloropyrimidine Basic information |
| | 4-Amino-5-bromo-6-chloropyrimidine Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | Solid | | color | Gray | | InChI | InChI=1S/C4H3BrClN3/c5-2-3(6)8-1-9-4(2)7/h1H,(H2,7,8,9) | | InChIKey | DQSBRYJETNYGCI-UHFFFAOYSA-N | | SMILES | C1=NC(Cl)=C(Br)C(N)=N1 |
| Risk Statements | 41 | | Safety Statements | 26-39 | | HS Code | 2933599590 |
| | 4-Amino-5-bromo-6-chloropyrimidine Usage And Synthesis |
| | 4-Amino-5-bromo-6-chloropyrimidine Preparation Products And Raw materials |
|