| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
Diethyl 2,6-dimethyl-3,5-pyridinedicarboxylate manufacturers
|
| | Diethyl 2,6-dimethyl-3,5-pyridinedicarboxylate Basic information |
| Product Name: | Diethyl 2,6-dimethyl-3,5-pyridinedicarboxylate | | Synonyms: | 2,6-Dimethyl-3,5-pyridinedicarboxylic acid diethyl ester;2,6-Dimethylpyridine-3,5-bis(carboxylic acid ethyl) ester;2,6-dimethylpyridine-3,5-dicarboxylic acid diethyl ester;3,5-diethyl 2,6-diMethylpyridine-3,5-dicarboxylate;Diethyl 2,6-diMethylpyridine-3,5-dicarboxylate 99%;3,5-Pyridinedicarboxylic acid, 2,6-dimethyl-, diethyl ester;3,5-Pyridinedicarboxylic acid, 2,6-dimethyl-, 3,5-diethyl ester;DIETHYL 2,6-DIMETHYL-3,5-PYRIDINEDICARBOXYLATE ISO 9001：2015 REACH | | CAS: | 1149-24-2 | | MF: | C13H17NO4 | | MW: | 251.28 | | EINECS: | | | Product Categories: | C9 to C46;Heterocyclic Building Blocks;Pyridines;Heterocyclic Compounds;Building Blocks;C13 to C15;Chemical Synthesis;Heterocyclic Building Blocks | | Mol File: | 1149-24-2.mol |  |
| | Diethyl 2,6-dimethyl-3,5-pyridinedicarboxylate Chemical Properties |
| Melting point | 72-74 °C (lit.) | | Boiling point | 208 °C/40 mmHg (lit.) | | density | 1.1667 (rough estimate) | | refractive index | 1.4800 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 2.81±0.20(Predicted) | | color | White to Orange to Green | | InChI | 1S/C13H17NO4/c1-5-17-12(15)10-7-11(13(16)18-6-2)9(4)14-8(10)3/h7H,5-6H2,1-4H3 | | InChIKey | DIIWSYPKAJVXBV-UHFFFAOYSA-N | | SMILES | CCOC(=O)c1cc(C(=O)OCC)c(C)nc1C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2933.39.9200 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Diethyl 2,6-dimethyl-3,5-pyridinedicarboxylate Usage And Synthesis |
| Uses | Diethyl 2,6-dimethylpyridine-3,5-dicarboxylate is formed during the oxidation of 4-substituted Hantsch dihydropyridines in presence of methanesulfonic acid, sodium nitrite and wet SiO2 as oxidizing agents. | | Synthesis Reference(s) | Organic Syntheses, Coll. Vol. 2, p. 214, 1943
Tetrahedron, 28, p. 5911, 1972
Tetrahedron Letters, 34, p. 623, 1993 DOI: 10.1016/S0040-4039(00)61635-0 | | General Description | Diethyl 2,6-dimethylpyridine-3,5-dicarboxylate is formed during the oxidation of 4-substituted Hantsch dihydropyridines in presence of methanesulfonic acid, sodium nitrite and wet SiO2 as oxidizing agents. |
| | Diethyl 2,6-dimethyl-3,5-pyridinedicarboxylate Preparation Products And Raw materials |
|