|
|
| | 2-Bromo-6-methoxypyrimidine Basic information |
| | 2-Bromo-6-methoxypyrimidine Chemical Properties |
| density | 1.628 | | storage temp. | 2-8°C | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C5H5BrN2O/c1-9-4-2-3-7-5(6)8-4/h2-3H,1H3 | | InChIKey | OHOBULDCIMBMDH-UHFFFAOYSA-N | | SMILES | C1(Br)=NC=CC(OC)=N1 |
| | 2-Bromo-6-methoxypyrimidine Usage And Synthesis |
| Uses | 2-Bromo-4-methoxypyrimidine is a chemical reagent used in the synthesis of oxopiperidine derivatives as anti-migrane agents. As well as in the preparation of organic electroluminescent devices. |
| | 2-Bromo-6-methoxypyrimidine Preparation Products And Raw materials |
|