5-Bromo-4-azaindole manufacturers
- 5-Bromo-4-azaindole
-
- $1.00 / 1g
-
2019-12-27
- CAS:1000341-51-4
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 200kg
|
| | 5-Bromo-4-azaindole Basic information |
| Product Name: | 5-Bromo-4-azaindole | | Synonyms: | 5-Bromo-4-azaindole;1H-Pyrrolo[3,2-b]pyridine, 5-broMo-;5-Bromo-1H-pyrrolo[3,2-b]pyridine5-Bromo-4-azaindole;5-Bromo-5-azaindole;5-Bromo-4-azaindole 94% | | CAS: | 1000341-51-4 | | MF: | C7H5BrN2 | | MW: | 197.03 | | EINECS: | | | Product Categories: | Azaindoles | | Mol File: | 1000341-51-4.mol |  |
| | 5-Bromo-4-azaindole Chemical Properties |
| Boiling point | 332.2±22.0 °C(Predicted) | | density | 1.770±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 13.70±0.40(Predicted) | | form | solid | | Appearance | Off-white to light brown Solid | | InChI | InChI=1S/C7H5BrN2/c8-7-2-1-5-6(10-7)3-4-9-5/h1-4,9H | | InChIKey | KJTANNMEOBCHKP-UHFFFAOYSA-N | | SMILES | C12C=CNC1=CC=C(Br)N=2 |
| WGK Germany | WGK 3 | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 5-Bromo-4-azaindole Usage And Synthesis |
| Uses | 5-Bromo-4-azaindole is used as an organic synthesis intermediate or pharmaceutical intermediate for the synthesis of
6-bromo-1H-pyrrolo[3,2-b]pyridine-3-carbaldehyde. |
| | 5-Bromo-4-azaindole Preparation Products And Raw materials |
|