| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | 3-Methyluric acid-13C4,15N3 Basic information |
| Product Name: | 3-Methyluric acid-13C4,15N3 | | Synonyms: | 3-Methyluric acid-13C4,15N3;3-Methyluric acid-2,4,5,6-13C4, 1,3,9-15N3 >=98 atom %, >=98% (CP);3-Methyluric acid-2,4,5,6-13C?, 1,3,9-1?N?;3-Methyluric acid-2,4,5,6-13C4, 1,3,9-15N3;3-Methyluric Acid-[13C4,15N3] (Standard) | | CAS: | 1173019-10-7 | | MF: | C6H6N4O3 | | MW: | 189.19984 | | EINECS: | | | Product Categories: | Isolabel | | Mol File: | 1173019-10-7.mol |  |
| | 3-Methyluric acid-13C4,15N3 Chemical Properties |
| Melting point | >300 °C | | storage temp. | -20°C | | form | powder | | InChI | InChI=1S/C6H6N4O3/c1-10-3-2(7-5(12)8-3)4(11)9-6(10)13/h1H3,(H2,7,8,12)(H,9,11,13)/i2+1,3+1,4+1,6+1,8+1,9+1,10+1 | | InChIKey | ODCYDGXXCHTFIR-BYSJPOJGSA-N | | SMILES | [13C]12[15NH]C(N[13C]=1[13C]([15NH][13C](=O)[15N]2C)=O)=O |
| WGK Germany | WGK 2 | | Storage Class | 11 - Combustible Solids |
| | 3-Methyluric acid-13C4,15N3 Usage And Synthesis |
| Uses | 3-Methyluric Acid-13C4,15N3 is the 13C and 15N labeled 3-Methyluric Acid[1]. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019 Feb;53(2):211-216. DOI:10.1177/1060028018797110 |
| | 3-Methyluric acid-13C4,15N3 Preparation Products And Raw materials |
|