| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | L-TYROSINE-2,3,5,6-D4 Basic information |
| Product Name: | L-TYROSINE-2,3,5,6-D4 | | Synonyms: | L-TYROSINE (RING-D4);L-TYROSINE-2,3,5,6-D4;L-TYROSINE-2,3,5,6-D4, 98 ATOM % D;l-4-hydroxyphenyl-2,3,5,6-d4-alanine;l-tyrosine-d4(phenyl-d4);L-Tyrosine-(phenyl-d4)
;OUYCCCASQSFEME-FCDGGRDXSA-N;[2H4]-L-Tyrosine | | CAS: | 62595-14-6 | | MF: | C9H7D4NO3 | | MW: | 185.21 | | EINECS: | | | Product Categories: | Amino Acids 13C, 2H, 15N | | Mol File: | 62595-14-6.mol |  |
| | L-TYROSINE-2,3,5,6-D4 Chemical Properties |
| Melting point | >300 °C (dec.)(lit.) | | Boiling point | 385.163±32.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.334±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | Refrigerator | | solubility | Aqueous Acid (Slightly, Sonicated), Aqueous Base (Slightly) | | form | Solid | | pka | 2.254±0.10(predicted) | | color | White to Pale Beige | | Appearance | white powder | | Optical Rotation | [α]25/D -12°, c = 1 in 1 M HCl | | InChI | 1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1/i1D,2D,3D,4D | | InChIKey | OUYCCCASQSFEME-FCDGGRDXSA-N | | SMILES | [H][C@](N)(Cc1c([2H])c([2H])c(O)c([2H])c1[2H])C(O)=O | | CAS Number Unlabeled | 60-18-4 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | L-TYROSINE-2,3,5,6-D4 Usage And Synthesis |
| Description | L-Tyrosine-(phenyl-d4) is one of the labeled with stable isotopes of an aromatic amino acid, L-tyrosine.
Amino acid with a phenyl ring, in which four hydrogen atoms on the benzene ring are replaced by deuterium. | | Uses | L-TYROSINE-2,3,5,6-D4 is one of the 22 proteinogenic amino acids that are used by cells to synthesize proteins. L-TYROSINE-2,3,5,6-D4 is biologically converted from L-phenylalanine and is in turn is converted to L-DOPA and further converted into the neurotransmitters: dopamine, norepinephrine, and epinephrine. This is the labeled analog. | | Uses | L-Tyrosine is one of the 22 proteinogenic amino acids that are used by cells to synthesize proteins. L-Tyrosine is biologically converted from L-phenylalanine and is in turn is converted to L-DOPA and further converted into the neurotransmitters: dopamine, norepinephrine, and epinephrine. This is the labeled analog. | | Definition | ChEBI: L-tyrosine-d4 is a L-tyrosine and a deuterated compound. |
| | L-TYROSINE-2,3,5,6-D4 Preparation Products And Raw materials |
|