|
|
| | Emodin 8-glucoside Basic information |
| Product Name: | Emodin 8-glucoside | | Synonyms: | C10345;Emodin 8-glucoside;1,3-dihydroxy-6-methyl-8-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)anthracene-9,10-dione;Emodin 1-β-D-Glucoside;Emodin-1-O-β-D-glucoside;modin 1-glucoside;Emodin-1-Beta-D-Glucoside;9,10-Anthracenedione, 1-(β-D-glucopyranosyloxy)-6,8-dihydroxy-3-methyl- | | CAS: | 38840-23-2 | | MF: | C21H20O10 | | MW: | 432.38 | | EINECS: | | | Product Categories: | | | Mol File: | 38840-23-2.mol |  |
| | Emodin 8-glucoside Chemical Properties |
| Melting point | 239-241℃ | | Boiling point | 834.5±65.0 °C(Predicted) | | density | 1.667±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly, Heated) | | form | Solid | | pka | 6.45±0.20(Predicted) | | color | Yellow to Dark Yellow | | Stability: | Hygroscopic | | InChIKey | ZXXFEBMBNPRRSI-FMQABLMVNA-N | | SMILES | C1(O)=C2C(C(=O)C3=C(C2=O)C(O[C@H]2[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O2)=CC(C)=C3)=CC(O)=C1 |&1:12,13,15,17,19,r| |
| | Emodin 8-glucoside Usage And Synthesis |
| Chemical Properties | Pale yellow powder, soluble in organic solvents such as methanol, ethanol, and DMSO. It comes from the dried roots and rhizomes of Rheum palmatum and Polygonum multiflorum of the Polygonaceae family. | | Uses | Emodin 1-β-D-Glucoside is an impurity formed in the synthesis of glucoside metabolites of Emodin (E523000). |
| | Emodin 8-glucoside Preparation Products And Raw materials |
|