| Company Name: |
parabiochem |
| Tel: |
025-83453382-8005 |
| Email: |
sale@parabiochem.com |
|
| | DL-Chlorophenylglycine methyl ester hydrochloride Basic information |
| Product Name: | DL-Chlorophenylglycine methyl ester hydrochloride | | Synonyms: | DL-Chlorophenylglycine methyl ester hydrochloride;Methyl Amino(2-chlorophenyl)acetate;(+/-) CHLOROPHEYL GLYCINE METHYL ESTER;2-(2-chlorophenyl)glycine methyl ester hydrochloride;(2S,2'S)-dimethyl 2,2'-(2,2'-methylenebis(6,7-dihydrothieno[3,2-c]pyridine-5,2(4H)-diyl))bis(2-(2-chlorophenyl)acetate);Benzeneacetic acid, α-amino-2-chloro-, methyl ester;(2S,2'S)-dimethyl 2,2'-(2,2'-methylenebis(6,7-dihydrothieno[3,2-c]pyridine-5,2(4H)-diyl))bis(2-(2-chlorophenyl)acetate) dihydrochloride;METHYL 2-AMINO-2-(2-CHLOROPHENYL)ACETATE | | CAS: | 141109-13-9 | | MF: | C9H10ClNO2 | | MW: | 199.63 | | EINECS: | | | Product Categories: | | | Mol File: | 141109-13-9.mol |  |
| | DL-Chlorophenylglycine methyl ester hydrochloride Chemical Properties |
| Boiling point | 270.1±25.0 °C(Predicted) | | density | 1.258±0.06 g/cm3(Predicted) | | pka | 6.15±0.10(Predicted) | | InChI | InChI=1S/C9H10ClNO2/c1-13-9(12)8(11)6-4-2-3-5-7(6)10/h2-5,8H,11H2,1H3 | | InChIKey | UTWOZNRDJNWTPS-UHFFFAOYSA-N | | SMILES | C(C1C=CC=CC=1Cl)(N)C(=O)OC |
| | DL-Chlorophenylglycine methyl ester hydrochloride Usage And Synthesis |
| | DL-Chlorophenylglycine methyl ester hydrochloride Preparation Products And Raw materials |
|