| Company Name: |
Varanous Labs Pvt Ltd
|
| Tel: |
+91-7036248882 |
| Email: |
bheemashankar.e@varanouslabs.com |
| Products Intro: |
Product Name:Oxymetazoline EP Impurity C CAS:55699-13-3 Purity:98% Package:1 kg,5 kg, 10 kg,25kg and 1 MT
|
| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:4-tert-Butyl-2,6-diMethyl-3-hydroxyphenylacetaMide (OxyMetazoline IMpurity) CAS:55699-13-3 Package:100Mg,10Mg
|
|
| | 4-tert-Butyl-2,6-dimethyl-3-hydroxyphenylacetamide
(Oxymetazoline hydrochloride impurity) Basic information |
| | 4-tert-Butyl-2,6-dimethyl-3-hydroxyphenylacetamide
(Oxymetazoline hydrochloride impurity) Chemical Properties |
| Melting point | 196 - 198°C | | storage temp. | Refrigerator | | solubility | DMSO Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChI | 1S/C14H21NO2/c1-8-6-11(14(3,4)5)13(17)9(2)10(8)7-12(15)16/h6,17H,7H2,1-5H3,(H2,15,16) | | InChIKey | SZXVVIYVCJXDSD-UHFFFAOYSA-N | | SMILES | NC(=O)Cc1c(c(c(cc1C)C(C)(C)C)O)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 4-tert-Butyl-2,6-dimethyl-3-hydroxyphenylacetamide
(Oxymetazoline hydrochloride impurity) Usage And Synthesis |
| Uses | Oxymetazoline (O876470) impurity. |
| | 4-tert-Butyl-2,6-dimethyl-3-hydroxyphenylacetamide
(Oxymetazoline hydrochloride impurity) Preparation Products And Raw materials |
|