| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
Diethyl phenylphosphonite manufacturers
|
| | Diethyl phenylphosphonite Basic information |
| Product Name: | Diethyl phenylphosphonite | | Synonyms: | DIETHOXYPHENYLPHOSPHINE;phenyl-phosphonousacidiethylester;Phenylphosphonous acid diethyl ester;DIETHYL PHENYLPHOSPHONITE 97%;Diethyl phenylphosphinite;Diethyl phenylphophonite;Phenyldiethoxyphosphine;Diethyl phenylphosphonite,99% | | CAS: | 1638-86-4 | | MF: | C10H15O2P | | MW: | 198.2 | | EINECS: | 216-676-7 | | Product Categories: | Ligand | | Mol File: | 1638-86-4.mol |  |
| | Diethyl phenylphosphonite Chemical Properties |
| Boiling point | 64°C 0,7mm | | density | 1.032 g/mL at 25 °C(lit.) | | vapor pressure | 47.5Pa at 50℃ | | refractive index | n20/D 1.51(lit.) | | Fp | >230 °F | | storage temp. | Inert atmosphere,2-8°C | | form | clear liquid | | color | Colorless to Almost colorless | | Sensitive | Air Sensitive | | BRN | 2804900 | | InChI | InChI=1S/C10H15O2P/c1-3-11-13(12-4-2)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 | | InChIKey | RVDJLKVICMLVJQ-UHFFFAOYSA-N | | SMILES | C1=CC=C(P(OCC)OCC)C=C1 | | LogP | 2.17 at 25℃ | | CAS DataBase Reference | 1638-86-4 | | EPA Substance Registry System | Phosphonous acid, phenyl-, diethyl ester (1638-86-4) |
| Risk Statements | 36/37/38 | | Safety Statements | 24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29199000 |
| | Diethyl phenylphosphonite Usage And Synthesis |
| Chemical Properties | clear colourless liquid | | Uses | Diethyl phenylphosphonite is an aromatic compound with catalytic and antibacterial applications. |
| | Diethyl phenylphosphonite Preparation Products And Raw materials |
|