| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
Methyldiethoxyphosphine manufacturers
|
| | Methyldiethoxyphosphine Basic information |
| Product Name: | Methyldiethoxyphosphine | | Synonyms: | DIETHOXYMETHYLPHOSPHINE;METHYLDIETHOXYPHOSPHINE;O,O-diethyl methylphosphonite;Methyldiethoxyphosphine,99%;METHYL-PHOSPHONOUS ACI DIETHYL ESTER;Methylphosphonous acid diethyl ester;Methyldiethoxyphosphine, min. 95%;Diethyl Methylphosphite | | CAS: | 15715-41-0 | | MF: | C5H13O2P | | MW: | 136.13 | | EINECS: | 239-805-9 | | Product Categories: | Phosphorus compounds | | Mol File: | 15715-41-0.mol |  |
| | Methyldiethoxyphosphine Chemical Properties |
| Boiling point | 47 °C(Press: 50 Torr) | | density | 0,9 g/cm3 | | refractive index | 1.4168 | | Fp | 38°C | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Liquid | | Water Solubility | It slowly hydrolyses in water. | | Sensitive | Air & Moisture Sensitive | | Stability: | Air and Moisture Sensitive | | InChI | InChI=1S/C5H13O2P/c1-4-6-8(3)7-5-2/h4-5H2,1-3H3 | | InChIKey | NSSMTQDEWVTEKN-UHFFFAOYSA-N | | SMILES | P(C)(OCC)OCC | | EPA Substance Registry System | Phosphonous acid, methyl-, diethyl ester (15715-41-0) |
| Hazard Codes | Xn | | Risk Statements | 10-36/37/38-22 | | Safety Statements | 16-26-36/37/39 | | RIDADR | 1993 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 6.1 | | PackingGroup | II | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Oral
Flam. Liq. 3 |
| Provider | Language |
|
ALFA
| English |
| | Methyldiethoxyphosphine Usage And Synthesis |
| Uses | Dimethyl methylphosphonate is a phosphonite reagent used in the generation of phosphinic acid derivative via Arbuzov reaction and as a cyclization reagentin the preparation of 2-substituted penems. It is a chiral intermediate. | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: ligand |
| | Methyldiethoxyphosphine Preparation Products And Raw materials |
|