|
|
| | 9,9-Dihexyl-9H-fluoren-2-boronic acid Basic information |
| Product Name: | 9,9-Dihexyl-9H-fluoren-2-boronic acid | | Synonyms: | 9,9-Dihexyl-9H-fluoren-2-boronic acid;(9,9-Dihexyl-9H-fluoren-2-yl)boronic acid;B-(9,9-dihexyl-9H-fluoren-2-yl)Boronic acid;9,9-Di-n-hexylfluorene-2-boronic acid;9,9-Dihexylfluorene-2-boronic Acid (contains varying amounts of Anhydride);Boronic acid, B-(9,9-dihexyl-9H-fluoren-2-yl)-;9,9-Dihexylfluorene-2-boronic Acid;(9,9-dihexylfluoren-2-yl)boronicaci | | CAS: | 371193-08-7 | | MF: | C25H35BO2 | | MW: | 378.36 | | EINECS: | | | Product Categories: | | | Mol File: | 371193-08-7.mol |  |
| | 9,9-Dihexyl-9H-fluoren-2-boronic acid Chemical Properties |
| Melting point | 98°C(lit.) | | Boiling point | 542.2±53.0 °C(Predicted) | | density | 1.05±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | powder to crystal | | pka | 8.63±0.40(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C25H35BO2/c1-3-5-7-11-17-25(18-12-8-6-4-2)23-14-10-9-13-21(23)22-16-15-20(26(27)28)19-24(22)25/h9-10,13-16,19,27-28H,3-8,11-12,17-18H2,1-2H3 | | InChIKey | WWASBXIXSWJVJW-UHFFFAOYSA-N | | SMILES | B(C1C=CC2C3=C(C(CCCCCC)(CCCCCC)C=2C=1)C=CC=C3)(O)O |
| | 9,9-Dihexyl-9H-fluoren-2-boronic acid Usage And Synthesis |
| | 9,9-Dihexyl-9H-fluoren-2-boronic acid Preparation Products And Raw materials |
|