| Company Name: |
Clickchem Research LLP
|
| Tel: |
+91-8140031133 |
| Email: |
mayur@clickchemresearch.com |
| Products Intro: |
Product Name:SIMVASTATIN IMPURITY M
CAS:864357-87-9
Purity:90 % Above Package:25 mg, 100 mg, 250 mg, 500 mg and 1.0 gm
|
| Company Name: |
Allmpus Laboratories Pvt Ltd
|
| Tel: |
+91-9518738415 +91-9167862134 |
| Email: |
info@allmpus.com |
| Products Intro: |
Product Name:Simvastatin EP Impurity M
CAS:864357-87-9
Purity:97.94 Package:Customize Packaging (As per customer requirement in Miligram)
|
| Company Name: |
Nanjing XiZe Biotechnology CO., Ltd. Gold
|
| Tel: |
025-66023220 15250997978 |
| Email: |
1511893459@qq.com |
| Products Intro: |
Product Name:Simvastatin Hydroxy Acid Ethyl Ester
CAS:864357-87-9
Purity:95% HPLC Package:10mg;25mg;50mg;100mg;250mg;500mg;1g
|
|
| | SiMvastatin Hydroxy Acid Ethyl Ester Basic information |
| Product Name: | SiMvastatin Hydroxy Acid Ethyl Ester | | Synonyms: | Simvastatin EP Impurity M;(βR,δR,1S,2S,6R,8S,8aR)-8-(2,2-DiMethyl-1-oxobutoxy)-1,2,6,7,8,8a-hexahydro-β,δ-dihydroxy-2,6-diMethyl-1-naphthaleneheptanoic Acid Ethyl Ester;SiMvastatin Hydroxy Ethyl Ester;Simvastatin Impurity M;1-Naphthaleneheptanoic acid, 8-(2,2-dimethyl-1-oxobutoxy)-1,2,6,7,8,8a-hexahydro-β,δ-dihydroxy-2,6-dimethyl-, ethyl ester, (βR,δR,1S,2S,6R,8S,8aR)-;Simvastatin Impurity 9（EP-G）;(3R,5R)-ethyl 7-((1S,2S,6R,8S,8aR)-8-((2,2-dimethylbutanoyl)oxy)-2,6-dimethyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl)-3,5-dihydroxyheptanoate;Simvastatin Impurity 49 | | CAS: | 864357-87-9 | | MF: | C27H44O6 | | MW: | 464.63 | | EINECS: | | | Product Categories: | Chiral Reagents;Heterocycles;Impurities;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 864357-87-9.mol |  |
| | SiMvastatin Hydroxy Acid Ethyl Ester Chemical Properties |
| Melting point | 58-61oC | | Boiling point | 585.9±50.0 °C(Predicted) | | density | 1.09±0.1 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | pka | 14.15±0.20(Predicted) | | form | Solid | | color | White | | Stability: | Hygroscopic | | InChIKey | VVAUQJHCHXQKFR-XKBQTBSHNA-N | | SMILES | [C@H]1(OC(=O)C(C)(C)CC)[C@@H]2[C@@H](CC[C@H](O)C[C@H](O)CC(=O)OCC)[C@@H](C)C=CC2=C[C@@H](C)C1 |&1:0,9,10,13,16,24,30,r| |
| | SiMvastatin Hydroxy Acid Ethyl Ester Usage And Synthesis |
| Chemical Properties | Colourless to Pale Yellow | | Uses | An impurity in Simvastatin (S485000). |
| | SiMvastatin Hydroxy Acid Ethyl Ester Preparation Products And Raw materials |
|