|
|
| | ACETYLSIMVASTATIN Basic information |
| Product Name: | ACETYLSIMVASTATIN | | Synonyms: | 2,2-DiMethylbutanoic Acid (1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-(Acetyloxy)tetrahydro
-6-oxo-2H-pyran-2-yl]ethyl]-1,2,3,7,8,8a-hexahydro-3,7-diMethyl-1-naphthalenyl Ester;SiMvastatin Acetate;SiMvastatin IMpurity-B;SiMvastatin IMpurity B (Acetyl SiMvastatin);ACETYLSIMVASTATIN;Simvastatin EP Impurity B;Simvastatin Impurity 2(Simvastatin EP Impurity B);(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-(acetyloxy)-6-oxotetrahydro-2H-pyran-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl 2,2-dimethylbutanoate | | CAS: | 145576-25-6 | | MF: | C27H40O6 | | MW: | 460.6 | | EINECS: | | | Product Categories: | Chiral Reagents;Impurities;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 145576-25-6.mol |  |
| | ACETYLSIMVASTATIN Chemical Properties |
| Melting point | 115-118°C | | Boiling point | 575.2±50.0 °C(Predicted) | | density | 1.11±0.1 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Acetonitrile (Slightly), Chloroform (Slightly), Ethyl Acetate (Slightly), Methan | | form | Solid | | color | White to Off-White | | Major Application | pharmaceutical (small molecule) | | InChIKey | OHVWRJDVJRNCPE-BIKFJBPRSA-N | | SMILES | O1[C@@H](C[C@H](CC1=O)OC(=O)C)CC[C@@H]2[C@H]3[C@H](C[C@H](C=C3C=C[C@@H]2C)C)OC(=O)C(CC)(C)C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | WGK 3 | | HS Code | 2932206000 | | Storage Class | 11 - Combustible Solids |
| | ACETYLSIMVASTATIN Usage And Synthesis |
| Uses | Simvastatin (S485000) impurity. |
| | ACETYLSIMVASTATIN Preparation Products And Raw materials |
|