| Company Name: |
Nanjing Chemlin Chemical Co., Ltd
|
| Tel: |
025-83697070 |
| Email: |
info@chemlin.com.cn |
| Products Intro: |
Product Name:7-Methyl-bicyclo[4.2.0]octa-1,3,5-triene
CAS:55337-80-9
Purity:0.98 Package:5KG; 1KG
|
1-Methyl-1,2-dihydrocyclobutabenzene manufacturers
|
| | 1-Methyl-1,2-dihydrocyclobutabenzene Basic information |
| | 1-Methyl-1,2-dihydrocyclobutabenzene Chemical Properties |
| Boiling point | 85-105 °C(Press: 105 Torr) | | density | 0.978±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C9H10/c1-7-6-8-4-2-3-5-9(7)8/h2-5,7H,6H2,1H3 | | InChIKey | DIIIHASDQIQOFX-UHFFFAOYSA-N | | SMILES | C12C(C(C)C1)=CC=CC=2 | | LogP | 2.34620 |
| | 1-Methyl-1,2-dihydrocyclobutabenzene Usage And Synthesis |
| Uses | 1-Methyl-1,2-dihydrocyclobutabenzene belongs to the benzocyclobutene (BCB) series of compounds; its structural features include a BCB active group and a methyl substituent. This compound is primarily used in research into perfluorinated BCBs and their derivatives. |
| | 1-Methyl-1,2-dihydrocyclobutabenzene Preparation Products And Raw materials |
|