|
|
| | Ticagrelor Sulphone Basic information |
| Product Name: | Ticagrelor Sulphone | | Synonyms: | Ticagrelor Sulphone;Ticagrelor Related Compound 41;(1S,2S,3R,5S)-3-((3-((1R,2S)-2-(3,4-difluorophenyl)cyclopropyl)-5-(propylthio)-3H-[1,2,3]triazolo[4,5-d]pyrimidin-7-yl)amino)-5-(2-hydroxyethoxy)cyclopentane-1,2-diol;N-((1R,2S)-2-(3,4-difluorophenyl)cyclopropyl)-N-(3-((1R,2S,3S,4S)-2,3-dihydroxy-4-(2-hydroxyethoxy)cyclopentyl)-5-(propylthio)-3H-[1,2,3]triazolo[4,5-d]pyrimidin-7-yl)nitrous amide;Ticagrelor impurity 8/Ticagrelor Triazole Isomer/(1S,2S,3R,5S)-3-[[3-[(1R,2S)-2-(3,4-Difluorophenyl)cyclopropyl]-5-(propylthio)-3H-1,2,3-triazolo[4,5-d]pyrimidin-7-yl]amino]-5-(2-hydroxyethoxy)-1,2-cyclopentanediol;Ticagrelor-5;Tigrelo Impurity E;Ticagrelor Triazole Isomer | | CAS: | 1788033-05-5 | | MF: | C23H28F2N6O4S | | MW: | 522.57 | | EINECS: | | | Product Categories: | | | Mol File: | 1788033-05-5.mol |  |
| | Ticagrelor Sulphone Chemical Properties |
| Boiling point | 777.6±70.0 °C(Predicted) | | density | 1.67±0.1 g/cm3(Predicted) | | solubility | Methanol (Slightly) | | form | Solid | | pka | 13+-.0.70(Predicted) | | color | White to Off-White | | Stability: | Hygroscopic | | Major Application | pharmaceutical | | InChIKey | TUIWICWAOCUWJD-FNOIDJSQSA-N | | SMILES | [C@@H]1(O)[C@@H](OCCO)C[C@@H](NC2N=C(SCCC)N=C3N([C@@H]4C[C@H]4C4=CC=C(F)C(F)=C4)N=NC3=2)[C@@H]1O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Ticagrelor Sulphone Usage And Synthesis |
| Uses | (1S,2S,3R,5S)-3-[[3-[(1R,2S)-2-(3,4-Difluorophenyl)cyclopropyl]-5-(propylthio)-3H-1,2,3-triazolo[4,5-d]pyrimidin-7-yl]amino]-5-(2-hydroxyethoxy)-1,2-cyclopentanediol is an impurity of Ticagrelor (T437700) which is an anticoagulant used in the treatment of acute coronary syndromes. |
| | Ticagrelor Sulphone Preparation Products And Raw materials |
|