| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | (S)-2-(3,4-Difluorophenyl)oxirane Basic information |
| Product Name: | (S)-2-(3,4-Difluorophenyl)oxirane | | Synonyms: | (S)-2-(3,4-Difluorophenyl)oxirane;Oxirane, 2-(3,4-difluorophenyl)-,(2S)-;Ticagrelor Impurity 100;(2S)-2-(3,4-Difluorophenyl)oxirane;2-(((3aR,4R,6R,6aS)-6-(6-(((1R,2S)-2-(3,4-difluorophenyl)cyclopropyl)amino)-2-(propylthio)-9H-purin-9-yl)-2,2-dimethyltetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl)oxy)ethanol | | CAS: | 1006376-63-1 | | MF: | C8H6F2O | | MW: | 156.13 | | EINECS: | | | Product Categories: | | | Mol File: | 1006376-63-1.mol |  |
| | (S)-2-(3,4-Difluorophenyl)oxirane Chemical Properties |
| Boiling point | 186.8±40.0 °C(Predicted) | | density | 1.335±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | form | liquid | | color | Colourless to light yellow | | InChI | InChI=1S/C8H6F2O/c9-6-2-1-5(3-7(6)10)8-4-11-8/h1-3,8H,4H2/t8-/m1/s1 | | InChIKey | UNJRFWWCCAHSRB-MRVPVSSYSA-N | | SMILES | O1C[C@@H]1C1=CC=C(F)C(F)=C1 |
| | (S)-2-(3,4-Difluorophenyl)oxirane Usage And Synthesis |
| Uses | (S)-2-(3,4-Difluorophenyl)oxirane is an impurity of ticagrelor and is used as a standard control. |
| | (S)-2-(3,4-Difluorophenyl)oxirane Preparation Products And Raw materials |
|