| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | 3-Benzyloxy-4-hydroxybenzaldehyde Basic information |
| | 3-Benzyloxy-4-hydroxybenzaldehyde Chemical Properties |
| Melting point | 113-114 °C | | Boiling point | 399.7±27.0 °C(Predicted) | | density | 1.238±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | DMSO, Ethyl Acetate (Slightly) | | form | Solid | | pka | 7.32±0.43(Predicted) | | color | White to Off-white | | InChI | InChI=1S/C14H12O3/c15-9-12-6-7-13(16)14(8-12)17-10-11-4-2-1-3-5-11/h1-9,16H,10H2 | | InChIKey | CWMRCRFALIQFHU-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=C(O)C(OCC2=CC=CC=C2)=C1 |
| | 3-Benzyloxy-4-hydroxybenzaldehyde Usage And Synthesis |
| Uses | 3-Benzyloxy-4-hydroxybenzaldehyde is a reactant used in the preparation of PDE4 and PDE7 inhibitors, insulin-like growth-factor-I receptor (IGF-IR) inhibitors and ferulic acid derivatives as xanthine oxidase inhibitors. |
| | 3-Benzyloxy-4-hydroxybenzaldehyde Preparation Products And Raw materials |
|