|
|
| | 3,4-Dibenzyloxybenzaldehyde Basic information | | Preparation |
| | 3,4-Dibenzyloxybenzaldehyde Chemical Properties |
| Melting point | 91-94 °C (dec.) (lit.) | | Boiling point | 492.4±35.0 °C(Predicted) | | density | 1.176±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Powder | | color | White to yellow | | BRN | 1132811 | | InChI | InChI=1S/C21H18O3/c22-14-19-11-12-20(23-15-17-7-3-1-4-8-17)21(13-19)24-16-18-9-5-2-6-10-18/h1-14H,15-16H2 | | InChIKey | XDDLXZHBWVFPRG-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=C(OCC2=CC=CC=C2)C(OCC2=CC=CC=C2)=C1 | | CAS DataBase Reference | 5447-02-9(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10 | | HS Code | 29125000 | | Storage Class | 11 - Combustible Solids |
| | 3,4-Dibenzyloxybenzaldehyde Usage And Synthesis |
| Preparation | 3,4-Dibenzyloxybenzaldehyde forms a 1:1 inclusion complex with cyclodextrin. It reacts with 3-acetyl-2,5-dimethylthiophene to produce the chalcone dye, (2E)-3-(3,4-dimethoxyphenyl)-1-(2,5-dimethylthiophene-3-yl)prop-2-en-1-one. | | Chemical Properties | Off-White Solid | | Uses | 3,4-Dibenzyloxybenzaldehyde (cas# 5447-02-9) is a compound useful in organic synthesis. |
| | 3,4-Dibenzyloxybenzaldehyde Preparation Products And Raw materials |
| Raw materials | Benzonitrile, 3,4-bis(phenylMethoxy)--->Benzene, 4-(bromomethyl)-1,2-bis(phenylmethoxy)--->Methyl 3,4-dihydroxybenzoate-->3,4-bis(benzyloxy)benzyl alcohol-->3-Hydroxy-4-benzyloxy benzaldehyde-->3-Benzyloxy-4-hydroxybenzaldehyde-->Methyl 3,4-bis(benzyloxy)benzoate-->Benzyl chloride-->Protocatechuic acid-->Benzyl alcohol-->Benzyl bromide | | Preparation Products | 3,4-Dihydroxyphenylacetamide-->6H-Dibenzo[b,d]pyran-6-one, 7-hydroxy-9-methoxy-2,3-bis(phenylmethoxy)--->lithospermic acid |
|