| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | Sodium 3-phosphoglycerate Basic information |
| Product Name: | Sodium 3-phosphoglycerate | | Synonyms: | SodiuM 1-hydroxy-3-(phosphonooxy)propan-2-olate;DL-α-Glycerophosphoric Acid Disodium Salt;Sodium 3-phosphoglycerate###3-Glycerophosphate;Sodium 1-hydroxy-3-(phosphonooxy);ALPHA-GLYCEROPHOSPHORIC ACID DISODIUM SALT;2,3-dihydroxypropyl (dihydrogen phosphate) sodium salt;DL-ALPHA-GLYCEROPHOSPHORIC ACID DISODIUM SALT;GLYCEROPHOSPHORIC ACID SODIUM SALT | | CAS: | 17603-42-8 | | MF: | C3H10NaO6P | | MW: | 196.07 | | EINECS: | 241-577-0 | | Product Categories: | APIs | | Mol File: | 17603-42-8.mol |  |
| | Sodium 3-phosphoglycerate Chemical Properties |
| storage temp. | 2-8°C | | solubility | Methanol (Slightly), Water (Slightly, Sonicated) | | form | Solid | | color | White to Off-White | | Cosmetics Ingredients Functions | ORAL CARE
ANTIPLAQUE | | InChI | InChI=1S/C3H9O6P.Na.H/c4-1-3(5)2-9-10(6,7)8;;/h3-5H,1-2H2,(H2,6,7,8);; | | InChIKey | RSABDVRRIDZAEA-UHFFFAOYSA-N | | SMILES | C(OP(O)(O)=O)C(O)CO.[NaH] | | CAS DataBase Reference | 17603-42-8(CAS DataBase Reference) | | EPA Substance Registry System | 1,2,3-Propanetriol, 1-(dihydrogen phosphate), sodium salt (17603-42-8) |
| WGK Germany | WGK 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids |
| | Sodium 3-phosphoglycerate Usage And Synthesis |
| Chemical Properties | Sodium 3-phosphoglycerate is colorless crystal or white crystalline powder; odorless and salty. It is a mixture of sodium α-glycerophosphate and sodium β-glycerophosphate. | | Uses | Sodium 3-phosphoglycerate can be used as a nutritional medicine. It is an intravenous phosphorus supplement to meet the body's daily phosphorus needs. | | Hazard | Long-term use of Sodium 3-phosphoglycerate can cause changes in blood phosphorus and calcium concentrations. |
| | Sodium 3-phosphoglycerate Preparation Products And Raw materials |
|