4-ACETYL-4'-METHYLBIPHENYL manufacturers
|
| | 4-ACETYL-4'-METHYLBIPHENYL Basic information |
| | 4-ACETYL-4'-METHYLBIPHENYL Chemical Properties |
| Melting point | 122 °C(Solv: ethanol (64-17-5)) | | Boiling point | 210-214 °C | | density | 1.038±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | form | powder to crystal | | color | White to Light yellow | | InChI | 1S/C15H14O/c1-11-3-5-14(6-4-11)15-9-7-13(8-10-15)12(2)16/h3-10H,1-2H3 | | InChIKey | GNIQQKORSMFYPE-UHFFFAOYSA-N | | SMILES | CC(=O)c1ccc(cc1)-c2ccc(C)cc2 | | CAS DataBase Reference | 5748-38-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HS Code | 2914.39.9000 | | Storage Class | 11 - Combustible Solids |
| | 4-ACETYL-4'-METHYLBIPHENYL Usage And Synthesis |
| | 4-ACETYL-4'-METHYLBIPHENYL Preparation Products And Raw materials |
|