| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
N-(2-Aminoethyl)-N-[[3-methoxy-4-(phenylmethoxy)phenyl]methyl]-2-thiophenecarboxamide hydrochloride manufacturers
|
| | N-(2-Aminoethyl)-N-[[3-methoxy-4-(phenylmethoxy)phenyl]methyl]-2-thiophenecarboxamide hydrochloride Basic information |
| Product Name: | N-(2-Aminoethyl)-N-[[3-methoxy-4-(phenylmethoxy)phenyl]methyl]-2-thiophenecarboxamide hydrochloride | | Synonyms: | M8-B hydrochloride;N-(2-Aminoethyl)-N-(4-(benzyloxy)-3-methoxybenzyl)thiophene-2-carboxamide hydrochloride;N-(2-Aminoethyl)-N-[[3-methoxy-4-(phenylmethoxy)phenyl]methyl]-2-thiophenecarboxamide hydrochloride;2-Thiophenecarboxamide, N-(2-aminoethyl)-N-[[3-methoxy-4-(phenylmethoxy)phenyl]methyl]-, monohydrochloride;M8-B;M8-B hydrochloride >=98% (HPLC);M8 B Hydrochloride,M-8-B Hydrochloride,M8B Hydrochloride;M8 B HCl | | CAS: | 883976-12-3 | | MF: | C22H25ClN2O3S | | MW: | 432.9635 | | EINECS: | | | Product Categories: | | | Mol File: | 883976-12-3.mol | ![N-(2-Aminoethyl)-N-[[3-methoxy-4-(phenylmethoxy)phenyl]methyl]-2-thiophenecarboxamide hydrochloride Structure](CAS/20180703/GIF/883976-12-3.gif) |
| | N-(2-Aminoethyl)-N-[[3-methoxy-4-(phenylmethoxy)phenyl]methyl]-2-thiophenecarboxamide hydrochloride Chemical Properties |
| storage temp. | 2-8°C | | solubility | H2O: soluble2mg/mL, clear (warmed) | | form | powder | | color | white to beige | | Water Solubility | H2O: 2mg/mL, clear (warmed) | | InChI | 1S/C22H24N2O3S.ClH/c1-26-20-14-18(9-10-19(20)27-16-17-6-3-2-4-7-17)15-24(12-11-23)22(25)21-8-5-13-28-21;/h2-10,13-14H,11-12,15-16,23H2,1H3;1H | | InChIKey | FMQJBHACRTZLME-UHFFFAOYSA-N | | SMILES | [s]1c(ccc1)C(=O)N(CCN)Cc2cc(c(cc2)OCc3ccccc3)OC.Cl |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | N-(2-Aminoethyl)-N-[[3-methoxy-4-(phenylmethoxy)phenyl]methyl]-2-thiophenecarboxamide hydrochloride Usage And Synthesis |
| Description | M8-B is an antagonist of transient receptor potential melastatin 8 (TRPM8) that blocks activation by cold, icilin , or menthol in vitro (IC50s = 7.8, 26.9, and 64.3 nM, respectively). It displays no effect at other TRP channels. M8-B decreases deep body temperature in wild-type mice and rats but has no effect on body temperature in TRPM8 KO mice. | | Uses | M8 B Hydrochloride is a channel blocker of cold receptor TRPM8. | | in vivo | M8-B (6 mg/kg; i.v. or i.p.) decreases deep body body temperature (Tb) in rats and mouse[1]. | Animal Model: | Trpm8+/+ rats and mice[1] | | Dosage: | 6 mg/kg | | Administration: | I.v. or i.p. | | Result: | Decreased deep body temperature (T(b)) in Trpm8+/+ rats and mice, but not in Trpm8/ mice. |
| | IC 50 | TRPM8 | | storage | Store at +4°C | | References | [1] M CAMILA ALMEIDA. Pharmacological blockade of the cold receptor TRPM8 attenuates autonomic and behavioral cold defenses and decreases deep body temperature.[J]. Journal of Neuroscience, 2012, 32 6: 2086-2099. DOI: 10.1523/jneurosci.5606-11.2012 |
| | N-(2-Aminoethyl)-N-[[3-methoxy-4-(phenylmethoxy)phenyl]methyl]-2-thiophenecarboxamide hydrochloride Preparation Products And Raw materials |
|