| Company Name: |
LGM Pharma |
| Tel: |
1-(800)-881-8210 |
| Email: |
inquiries@lgmpharma.com |
| Company Name: |
NCE Biomedical Co.,Ltd. |
| Tel: |
4000-027-021 |24 +86-13986109188 | +86-15623472865 | +81-08033611988 |
| Email: |
|
- Nipradilol
-
- $1.00
-
2019-07-31
- CAS:81486-22-8
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 300 Gram/Grams per Month
- NIPRADILOL
-
- $1.00
-
2019-07-06
- CAS:81486-22-8
- Min. Order: 1G
- Purity: 98%
- Supply Ability: 100KG
|
| | NIPRADILOL Basic information |
| Product Name: | NIPRADILOL | | Synonyms: | K 351;3,4-Dihydro-8-[2-hydroxy-3-[(1-methylethyl)amino]propoxy]-2H-1-benzopyran-3-ol 3-nitrate;Hypadil;Nipradolol;Nipranol;2H-1-Benzopyran-3-ol, 3,4-dihydro-8-(2-hydroxy-3-((1-methylethyl)amino)propoxy)-, 3-nitrate;3,4-Dihydro-8-(2-hydroxy-3-(isopropylamino)propoxy)-2H-1-benzopyran-3-ol 3-nitrate;3,4-Dihydro-8-(2-hydroxy-3-isopropylamino)propoxy-3-nitroxy-2H-1-benzopyran | | CAS: | 81486-22-8 | | MF: | C15H22N2O6 | | MW: | 326.35 | | EINECS: | | | Product Categories: | API | | Mol File: | 81486-22-8.mol |  |
| | NIPRADILOL Chemical Properties |
| Melting point | 110-122℃ | | Boiling point | 464.39°C (rough estimate) | | density | 1.1829 (rough estimate) | | refractive index | 1.6280 (estimate) | | Cosmetics Ingredients Functions | SKIN CONDITIONING | | InChI | InChI=1S/C15H22N2O6/c1-10(2)16-7-12(18)8-21-14-5-3-4-11-6-13(23-17(19)20)9-22-15(11)14/h3-5,10,12-13,16,18H,6-9H2,1-2H3 | | InChIKey | OMCPLEZZPVJJIS-UHFFFAOYSA-N | | SMILES | C1OC2=C(OCC(O)CNC(C)C)C=CC=C2CC1O[N+]([O-])=O |
| Toxicity | LD50 i.v. in mice, rats: 74.0, 73.0 mg/kg; orally in mice: 540 mg/kg (Shiratsuchi, 1988) |
| | NIPRADILOL Usage And Synthesis |
| Description | Nipradilol is a beta-blocker with vasodilatory activity. As an antihypertensive nipradilol
decreases systemic/pulmonary arterial blood pressure, heart rate, cardiac output and left
ventricular volume without causing tachycardia. Nipradilol is also reported to have
antiangina activity in dogs. | | Originator | Kowa (Japan) | | Uses | Nipradolol is a β-adrenoceptor blocking agent with antihypertensive properties.Nipradolol is used as ananti-glaucomatous agent. | | Definition | ChEBI: Hypadil (TN) is an organic molecular entity. | | Brand name | Hypadil |
| | NIPRADILOL Preparation Products And Raw materials |
|