| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
4-Phenylpyridine-N-oxide manufacturers
|
| | 4-Phenylpyridine-N-oxide Basic information | | Synthesis |
| | 4-Phenylpyridine-N-oxide Chemical Properties |
| Melting point | 153-155 °C(lit.) | | Boiling point | 301.18°C (rough estimate) | | density | 1.1242 (rough estimate) | | refractive index | 1.4900 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | form | powder to crystal | | pka | 0.89±0.10(Predicted) | | color | Light yellow to Brown | | BRN | 121493 | | InChI | 1S/C11H9NO/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H | | InChIKey | VZOPVKZLLGMDDG-UHFFFAOYSA-N | | SMILES | [O-][n+]1ccc(cc1)-c2ccccc2 | | CAS DataBase Reference | 1131-61-9(CAS DataBase Reference) | | EPA Substance Registry System | 4-Phenylpyridine-1-oxide (1131-61-9) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 3-9 | | TSCA | TSCA listed | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids |
| | 4-Phenylpyridine-N-oxide Usage And Synthesis |
| Synthesis | At 0°C, 70% m-CPBA (1 mol equivalent) was added in portions to a stirred solution of 5.5-6.7 mmol of 4-phenylpyridine in 2 mL of CHCl3. The resulting mixture was stirred at room temperature for 12 h, during which time the feedstock was observed to be completely consumed by TLC. The reaction mixture was diluted with CHCl3, and solid K2CO3 (4 mol equivalent) was added. The mixture was stirred for another 10 min, the solid was separated by filtration, the filtrate was dried with Na2SO4, and concentrated under reduced pressure to produce 4-phenylpyridine-N-oxide in 86-90% yield. 
| | Chemical Properties | beige to light brown crystalline powder | | Uses | 4-phenylpyridine n-oxide can be used as a catalyst for various reactions, such as, halogen bonding, and enantioselective epoxidation of non-selective alkenes leading to a higher catalytic activity. | | Uses | 4-Phenylpyridine N-oxide may be used in chemical synthesis studies. |
| | 4-Phenylpyridine-N-oxide Preparation Products And Raw materials |
|