|
|
| | 1,6-Dichloro-Isoquinoline Basic information |
| Product Name: | 1,6-Dichloro-Isoquinoline | | Synonyms: | 1,6-DICHLORO-ISOQUINOLINE;Isoquinoline, 1,6-dichloro-;Isoquinoline, 1,6-dichloro-1,6-DICHLORO-ISOQUINOLINE;Isoquinoline, 1 | | CAS: | 630421-73-7 | | MF: | C9H5Cl2N | | MW: | 198.05 | | EINECS: | 200-258-5 | | Product Categories: | | | Mol File: | 630421-73-7.mol |  |
| | 1,6-Dichloro-Isoquinoline Chemical Properties |
| Boiling point | 327.7±22.0 °C(Predicted) | | density | 1.407±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 1.48±0.38(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C9H5Cl2N/c10-7-1-2-8-6(5-7)3-4-12-9(8)11/h1-5H | | InChIKey | JTCCQIDTKFGEQY-UHFFFAOYSA-N | | SMILES | C1(Cl)C2=C(C=C(Cl)C=C2)C=CN=1 |
| | 1,6-Dichloro-Isoquinoline Usage And Synthesis |
| | 1,6-Dichloro-Isoquinoline Preparation Products And Raw materials |
|