- HAFNIUM
-
- $0.00 / 1kg
-
2022-09-27
- CAS:14873-63-3
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 1000kg
|
| | Bis(benzonitrile)dichloroplatinum(II) Basic information |
| Product Name: | Bis(benzonitrile)dichloroplatinum(II) | | Synonyms: | bis(Benzonitrile)dichloroplatinum;Dichlorobis(benzonitrile)platinum(II),99%;DICHLOROBIS(BENZONITRILE)PLATINUM (II);CIS-BIS(BENZONITRILE)DICHLOROPLATINUM(II);BIS(BENZONITRILE)DICHLOROPLATINATE (II);BIS(BENZONITRILE)DICHLOROPLATINUM(II);BIS(BENZONITRILE)PLATINUM(II) CHLORIDE;DICHLOROBIS(BENZONITRILE)PLATINUM(LL) | | CAS: | 14873-63-3 | | MF: | C14H10Cl2N2Pt | | MW: | 472.23 | | EINECS: | 238-943-7 | | Product Categories: | Pt;organometallic complexes | | Mol File: | 14873-63-3.mol |  |
| | Bis(benzonitrile)dichloroplatinum(II) Chemical Properties |
| Melting point | 224 °C (dec.)(lit.) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Slightly soluble in acetone, chloroform | | form | crystal | | color | yellow to orange | | Exposure limits | ACGIH: TWA 0.002 mg/m3
NIOSH: IDLH 4 mg/m3; TWA 0.002 mg/m3 | | InChI | 1S/2C7H5N.2ClH.Pt/c2*8-6-7-4-2-1-3-5-7;;;/h2*1-5H;2*1H;/q;;;;+2/p-2 | | InChIKey | WAJRCRIROYMRKA-UHFFFAOYSA-L | | SMILES | [Pt](Cl)(Cl)([NH]#Cc2ccccc2)[NH]#Cc1ccccc1 |
| Risk Statements | 20/21/22 | | Safety Statements | 26-36/37/39 | | RIDADR | UN3439 | | WGK Germany | 3 | | RTECS | TP2185000 | | HazardClass | 6.1 | | PackingGroup | III | | Storage Class | 11 - Combustible Solids |
| | Bis(benzonitrile)dichloroplatinum(II) Usage And Synthesis |
| Uses | Bis(benzonitrile)dichloroplatinum(II) is used as a catalyst for asymmetric hydroformylation reactions, allylation reactions, cyclopropanation reactions, hydrosilylation reactions and carbene insertion into O-H bonds of alcohols. | | Preparation | Bis(benzonitrile)dichloroplatinum(II) can be prepared as a mixture of cis and trans complexes. The reaction of Palladium(II) Chloride in benzonitrile at room temperature for 7 h yields a mixture that can be separated chromatographically to yield 26% trans- and 58% cis-PtCl2(PhCN)2. An alternate route requires stoichiometric amounts of potassium tetrachloroplatinate(II) and benzonitrile stirred at room temperature for one week. Trituration of the product with hot benzene yields pure cis-PtCl2(PhCN)2 in 60% yield; the cooled benzene solution yields pure trans-PtCl2(PhCN)2 in 20% yield. | | Purification Methods | chromatography on silica gel with dichloromethane as eluant, or trituration with hot benzene. |
| | Bis(benzonitrile)dichloroplatinum(II) Preparation Products And Raw materials |
|