| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
- 6-O-Methyl Guanosine
-
- $22.00
-
2026-08-25
- CAS:7803-88-5
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 50kg
|
| | 6-O-Methyl Guanosine Basic information |
| | 6-O-Methyl Guanosine Chemical Properties |
| Melting point | 120 °C(Solv: ethyl ether (60-29-7); methanol (67-56-1)) | | Boiling point | 721.0±70.0 °C(Predicted) | | density | 1.98±0.1 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Very Slightly), Water (Slightly) | | form | Solid | | pka | 13.07±0.70(Predicted) | | color | White to Pale Yellow | | Water Solubility | Water : 2 mg/mL (6.73 mM; Need ultrasonic and warming) | | InChI | InChI=1S/C11H15N5O5/c1-20-9-5-8(14-11(12)15-9)16(3-13-5)10-7(19)6(18)4(2-17)21-10/h3-4,6-7,10,17-19H,2H2,1H3,(H2,12,14,15)/t4-,6-,7-,10-/m1/s1 | | InChIKey | IXOXBSCIXZEQEQ-KQYNXXCUSA-N | | SMILES | OC[C@H]1O[C@@H](N2C3=C(C(=NC(=N3)N)OC)N=C2)[C@H](O)[C@@H]1O |
| | 6-O-Methyl Guanosine Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | A guanine derivative that acts as modulators of GTPases and modulator-resistant enzymes; used in drug design and target validation. | | Uses | 6-O-Methyl Guanosine is a guanine derivative that acts as modulators of GTPases and modulator-resistant enzymes; used in drug design and target validation |
| | 6-O-Methyl Guanosine Preparation Products And Raw materials |
|