|
|
| | 2-Chloro-5-nitronicotinic acid Basic information |
| | 2-Chloro-5-nitronicotinic acid Chemical Properties |
| Melting point | 140-143℃ | | Boiling point | 384.8±42.0 °C(Predicted) | | density | 1.702±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | form | Solid | | pka | 1.57±0.10(Predicted) | | color | White to yellow | | Sensitive | Moisture Sensitive | | InChI | InChI=1S/C6H3ClN2O4/c7-5-4(6(10)11)1-3(2-8-5)9(12)13/h1-2H,(H,10,11) | | InChIKey | WOFZRBCITDVRON-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC=C([N+]([O-])=O)C=C1C(O)=O | | CAS DataBase Reference | 42959-38-6(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | HazardClass | IRRITANT | | HS Code | 2933399990 |
| | 2-Chloro-5-nitronicotinic acid Usage And Synthesis |
| Synthesis |
2-Hydroxy-5-nitro-nicotinic acid (2.7 mmol) in a mixture of NJV- dimethylformamide (2.7 mmol) and thionyl chloride (5 ml) was heated at 80 0C for 1 h. The mixture was allowed to cool and concentrated in a vacuum. To the resulting residue, ice water (20 ml) was added, and with vigorous stirring, a precipitate formed. The precipitate was filtered off and dried in a vacuum oven to give a white solid 2-Chloro-5-nitronicotinic acid (68 percent).
| | References | [1] Journal of Medicinal Chemistry, 1992, vol. 35, # 10, p. 1887 - 1897
[2] Beilstein Journal of Organic Chemistry, 2009, vol. 5,
[3] Patent: EP904262, 2004, B1. Location in patent: Page 244
[4] Patent: WO2008/46135, 2008, A1. Location in patent: Page/Page column 42-43
[5] Bioorganic and Medicinal Chemistry Letters, 2000, vol. 10, # 11, p. 1151 - 1154 |
| | 2-Chloro-5-nitronicotinic acid Preparation Products And Raw materials |
|