- Hydroxy-PEG6-Boc
-
- $2.00
-
2026-08-25
- CAS:361189-64-2
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
- OH-PEG6-COOtBu
-
-
2026-07-24
- CAS:361189-64-2
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 1g/bottle, 10g/bottle, 100g/bottle
|
| | PEG7-t-butly ester Basic information |
| Product Name: | PEG7-t-butly ester | | Synonyms: | PEG7-t-butly ester;Hydroxy-PEG6-t-butly ester;Hydroxy-PEG6-t-butyl ester;OH-PEG6-CH2CH2COOtBu;OH-PEG6-TBA;HO-PEG4-t-Butyl ester;Hydroxy-PEG6-t-butyl ester 96%;HO-PEG6-COOtBu | | CAS: | 361189-64-2 | | MF: | C19H38O9 | | MW: | 410.5 | | EINECS: | | | Product Categories: | peg | | Mol File: | 361189-64-2.mol |  |
| | PEG7-t-butly ester Chemical Properties |
| Boiling point | 481.8±40.0 °C(Predicted) | | density | 1.076±0.06 g/cm3(Predicted) | | refractive index | n/D 1.454 | | storage temp. | -20°C | | pka | 14.36±0.10(Predicted) | | form | viscous liquid | | color | Colourless | | InChI | InChI=1S/C19H38O9/c1-19(2,3)28-18(21)4-6-22-8-10-24-12-14-26-16-17-27-15-13-25-11-9-23-7-5-20/h20H,4-17H2,1-3H3 | | InChIKey | VGGDPFAYSOSIOK-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)CCOCCOCCOCCOCCOCCOCCO |
| WGK Germany | WGK 3 | | HS Code | 2942000090 | | Storage Class | 10 - Combustible liquids |
| | PEG7-t-butly ester Usage And Synthesis |
| Description | Hydroxy-PEG6-t-butyl ester is a PEG linker containing a hydroxyl group with a t-butyl ester. The hydrophilic PEG spacer increases solubility in aqueous media. The hydroxyl group enables further derivatization or replacement with other reactive functional groups. The t-butyl protected carboxyl group can be deprotected under acidic conditions. | | Uses | This heterobifunctional, PEGylated crosslinker features a hydroxyl group at one end and t-butyl-protected carboxylic acid at the other, which can be deprotected with acidic conditions. The hydrophillic PEG linker facilitates solubility in biological applications. Hydroxy-PEG6-t-butyl ester can be used for bioconjugation or as a building block for synthesis of small molecules, conjugates of small molecules and/or biomolecules, or other tool compounds for chemical biology and medicinal chemistry that require ligation. Examples of applications include its synthetic incorporation into antibody-drug conjugates or roteolysis-targeting chimeras (PROTAC molecules) for targeted protein degradation. | | reaction suitability | reagent type: cross-linking reagent | | IC 50 | PEGs; Alkyl/ether |
| | PEG7-t-butly ester Preparation Products And Raw materials |
|