| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
- OH-PEG8-COOtBu
-
-
2026-07-24
- CAS:1334177-84-2
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 1g/bottle, 10g/bottle, 100g/bottle
|
| | Hydroxy-PEG8-t-butyl ester Basic information | | Purity |
| Product Name: | Hydroxy-PEG8-t-butyl ester | | Synonyms: | t-Butyl 3-Hydroxy(peg8)propionate;HO-PEG8-COOtBu;tert-Butyl 1-Hydroxy-3,6,9,12,15,18,21,24-octaoxaheptacosan-27-oate;PEG9-t-butly ester;2-Methyl-2-propanyl 1-hydroxy-3,6,9,12,15,18,21,24-octaoxaheptacosan-27-oate;OH-PEG8-CH2CH2COOtBu;OH-PEG8-TBA;Hydroxy-PEG8-t-butly ester | | CAS: | 1334177-84-2 | | MF: | C23H46O11 | | MW: | 498.6 | | EINECS: | | | Product Categories: | peg | | Mol File: | 1334177-84-2.mol |  |
| | Hydroxy-PEG8-t-butyl ester Chemical Properties |
| Boiling point | 549.5±45.0 °C(Predicted) | | density | 1.083±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in Water, DMSO, DMF, DCM | | pka | 14.36±0.10(Predicted) | | form | Liquid | | color | Colorless to light yellow | | InChI | InChI=1S/C23H46O11/c1-23(2,3)34-22(25)4-6-26-8-10-28-12-14-30-16-18-32-20-21-33-19-17-31-15-13-29-11-9-27-7-5-24/h24H,4-21H2,1-3H3 | | InChIKey | RBRDLMWBCQQRIQ-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCO |
| | Hydroxy-PEG8-t-butyl ester Usage And Synthesis |
| Purity | ＞98% | | Description | Hydroxy-PEG8-t-butyl ester is a PEG linker containing a hydroxyl group with a t-butyl ester. The hydrophilic PEG spacer increases solubility in aqueous media. The hydroxyl group enables further derivatization or replacement with other reactive functional groups. The t-butyl protected carboxyl group can be deprotected under acidic conditions. | | Uses | Hydroxy-PEG8-Boc is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. | | General Description | Hydroxy-PEG8-t-butyl ester (also known as Hydroxy-PEG8-Boc, Hydroxy-PEG8-Boc, HO-PEG8-CH2CH2COO-tBu and OH-PEG8-TBA, etc.; CAS 1334177-84-2) is a high-purity, monodisperse PEG cross-linking agent featuring terminal hydroxyl (-OH) groups and tert-butyl-protected carboxyl groups. This compound is widely used in the development of PROTACs and antibody-drug conjugates (ADCs) to enhance water solubility, improve biocompatibility, and facilitate sequential biocoupling. | | IC 50 | PEGs |
| | Hydroxy-PEG8-t-butyl ester Preparation Products And Raw materials |
|