- OH-PEG8-COOtBu
-
- $0.00 / 1g
-
2026-02-05
- CAS:1334177-84-2
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 1g/bottle, 10g/bottle, 100g/bottle
- HO-PEG8-CH2CH2COOtBu
-
- $0.00 / 1g
-
2026-01-29
- CAS:1334177-84-2
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 300kg
|
| | PEG9-t-butly ester Basic information |
| Product Name: | PEG9-t-butly ester | | Synonyms: | HO-PEG8-CH2CH2COOTBU;t-Butyl 3-Hydroxy(peg8)propionate;HO-PEG8-COOtBu;tert-Butyl 1-Hydroxy-3,6,9,12,15,18,21,24-octaoxaheptacosan-27-oate;PEG9-t-butly ester;2-Methyl-2-propanyl 1-hydroxy-3,6,9,12,15,18,21,24-octaoxaheptacosan-27-oate;OH-PEG8-CH2CH2COOtBu;OH-PEG8-TBA | | CAS: | 1334177-84-2 | | MF: | C23H46O11 | | MW: | 498.6 | | EINECS: | | | Product Categories: | peg | | Mol File: | 1334177-84-2.mol |  |
| | PEG9-t-butly ester Chemical Properties |
| Boiling point | 549.5±45.0 °C(Predicted) | | density | 1.083±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in Water, DMSO, DMF, DCM | | form | Liquid | | pka | 14.36±0.10(Predicted) | | color | Colorless to light yellow | | InChI | InChI=1S/C23H46O11/c1-23(2,3)34-22(25)4-6-26-8-10-28-12-14-30-16-18-32-20-21-33-19-17-31-15-13-29-11-9-27-7-5-24/h24H,4-21H2,1-3H3 | | InChIKey | RBRDLMWBCQQRIQ-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCO |
| | PEG9-t-butly ester Usage And Synthesis |
| Description | Hydroxy-PEG8-t-butyl ester is a PEG linker containing a hydroxyl group with a t-butyl ester. The hydrophilic PEG spacer increases solubility in aqueous media. The hydroxyl group enables further derivatization or replacement with other reactive functional groups. The t-butyl protected carboxyl group can be deprotected under acidic conditions. | | Uses | Hydroxy-PEG8-Boc is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. | | IC 50 | PEGs |
| | PEG9-t-butly ester Preparation Products And Raw materials |
|