|
|
| | N-Acetylglycyl-beta-alanine Basic information |
| Product Name: | N-Acetylglycyl-beta-alanine | | Synonyms: | N-Acetylglycyl-beta-alanine;3-(2-acetylamino-acetylamino)propionic acid;β-Alanine, N-acetylglycyl-;Ac-Gly-β-Ala-OH;3-(2-Acetamidoacetamido)propanoic acid;3-[(2-acetamidoacetyl)amino]propanoic acid | | CAS: | 1016788-34-3 | | MF: | C7H12N2O4 | | MW: | 188.18 | | EINECS: | 816-146-0 | | Product Categories: | | | Mol File: | 1016788-34-3.mol |  |
| | N-Acetylglycyl-beta-alanine Chemical Properties |
| Boiling point | 586.9±35.0 °C(Predicted) | | density | 1.249±0.06 g/cm3(Predicted) | | vapor pressure | 0.002-0.007Pa at 20-25℃ | | form | Solid:particulate/powder | | pka | 4.32±0.10(Predicted) | | Cosmetics Ingredients Functions | SKIN CONDITIONING | | InChI | InChI=1S/C7H12N2O4/c1-5(10)9-4-6(11)8-3-2-7(12)13/h2-4H2,1H3,(H,8,11)(H,9,10)(H,12,13) | | InChIKey | PEEDOBFPBBICBX-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCNC(=O)CNC(C)=O | | LogP | -1.72 at 21℃ and pH3.3-3.4 | | Surface tension | 70.7mN/m at 1g/L and 20℃ |
| | N-Acetylglycyl-beta-alanine Usage And Synthesis |
| Uses |
N-Acetylglycyl-beta-alanine is used as a cosmetic ingredient for skin conditioning.
| | Biological Functions |
N-acetylglycyl-BETA-alanine is a polypeptide compound with significant whitening effect. It can inhibit melanin production, reduce the melanin content in the skin, and block the transfer of melanin to the stratum corneum,slowing down the formation of spots.
| | Hazard | N-Acetylglycyl-beta-alanine (AGbetaA) is identified as readily biodegradable. In terms of acute aquatic toxicity, AGbetaA demonstrates a low toxicity risk, with EC50 values close to or above 100 mg/L. It indicates that AGbetaA pose minimal environmental risk[1]. | | References | [1] Mota, S., Rego, L., Sousa, E., Cruz, M. T., & de Almeida, I. M. (2025). Usage Frequency and Ecotoxicity of Skin Depigmenting Agents. Pharmaceuticals, 18 3. https://doi.org/10.3390/ph18030368
|
| | N-Acetylglycyl-beta-alanine Preparation Products And Raw materials |
|