2-Chloro-4,5,7-trimethylquinoline manufacturers
|
| | 2-Chloro-4,5,7-trimethylquinoline Basic information |
| | 2-Chloro-4,5,7-trimethylquinoline Chemical Properties |
| Boiling point | 333.6±37.0 °C(Predicted) | | density | 1.158±0.06 g/cm3(Predicted) | | pka | 1.71±0.50(Predicted) | | InChI | InChI=1S/C12H12ClN/c1-7-4-8(2)12-9(3)6-11(13)14-10(12)5-7/h4-6H,1-3H3 | | InChIKey | LPTKXGDEXQXRMU-UHFFFAOYSA-N | | SMILES | N1C2C(=C(C)C=C(C)C=2)C(C)=CC=1Cl |
| | 2-Chloro-4,5,7-trimethylquinoline Usage And Synthesis |
| Uses | 2-Chloro-4,5,7-trimethylquinoline can be used as an intermediate to synthesize organometallic compounds. Moreover, this particular organic metal compound can function as a dopant in the light-emitting layer of organic light-emitting diodes (OLEDs), resulting in reduced operating voltage requirements for OLEDs and enhanced efficiency and lifespan properties for these devices. |
| | 2-Chloro-4,5,7-trimethylquinoline Preparation Products And Raw materials |
|