|
|
| | 5-amino-2-hydroxy-4-sulfobiphenyl-3-carboxylicacid Basic information |
| Product Name: | 5-amino-2-hydroxy-4-sulfobiphenyl-3-carboxylicacid | | Synonyms: | 5-Amino-3-(4-sulfonylphenyl)salicyclic Acid;3-(4-Sulfophenyl)-5-aminosalicylic Acid RS*;Mesalamine EP Impurity P;5-amino-2-hydroxy-4'-sulfo-[1,1'-biphenyl]-3-carboxylic acid;5-Amino-2-hydroxy-4;Mesalazine Impurity 16(Mesalazine EP Impurity P);Mesalazine (Mesalamine) EP Impurity P;[1,1'-Biphenyl]-3-carboxylic acid, 5-amino-2-hydroxy-4'-sulfo- | | CAS: | 887256-40-8 | | MF: | C13H11NO6S | | MW: | 309.29 | | EINECS: | | | Product Categories: | | | Mol File: | 887256-40-8.mol |  |
| | 5-amino-2-hydroxy-4-sulfobiphenyl-3-carboxylicacid Chemical Properties |
| Melting point | >272°C (dec.) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly) | | form | Solid | | color | White to Light Brown | | Stability: | Hygroscopic | | InChI | InChI=1S/C13H11NO6S/c14-8-5-10(12(15)11(6-8)13(16)17)7-1-3-9(4-2-7)21(18,19)20/h1-6,15H,14H2,(H,16,17)(H,18,19,20) | | InChIKey | JFHCLENXDPFHHY-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(S(O)(=O)=O)C=C2)=CC(N)=CC(C(O)=O)=C1O |
| | 5-amino-2-hydroxy-4-sulfobiphenyl-3-carboxylicacid Usage And Synthesis |
| Uses | 5-Amino-2-hydroxy-4''-sulfo[1,1''-biphenyl]-3-carboxylic Acid is the free form of 5-Amino-2-hydroxy-4''-sulfo[1,1''-biphenyl]-3-carboxylic Acid Hydrochloride (A629343), which is the hydrochloride salt of 5-Amino-3-(4-sulfonylphenyl)salicyclic Acid Sodium Salt (A629340), an impurity of mesalamine (M258100) that is the active metabolite of Sulfasalazine (S699084). Anti-inflammatory (gastrointestinal). | | IC 50 | PPAR; PAK1; NF-κB |
| | 5-amino-2-hydroxy-4-sulfobiphenyl-3-carboxylicacid Preparation Products And Raw materials |
|