| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Diethyl 4-chlorobenzylphosphonate Basic information |
| | Diethyl 4-chlorobenzylphosphonate Chemical Properties |
| Boiling point | 162 °C(lit.) | | density | 1.19 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.509(lit.) | | Fp | 230 °F | | storage temp. | Sealed in dry,Room Temperature | | form | Liquid | | color | Clear colorless | | BRN | 1346690 | | InChI | 1S/C11H16ClO3P/c1-3-14-16(13,15-4-2)9-10-5-7-11(12)8-6-10/h5-8H,3-4,9H2,1-2H3 | | InChIKey | BVQPVBZRJSFOEZ-UHFFFAOYSA-N | | SMILES | CCOP(=O)(Cc1ccc(Cl)cc1)OCC | | CAS DataBase Reference | 39225-17-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26 | | WGK Germany | 3 | | HS Code | 29319000 | | Storage Class | 12 - Non Combustible Liquids |
| | Diethyl 4-chlorobenzylphosphonate Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | Reactant for:
- Preparation of chromenone and chromene derivatives as anti-picornavirus capsid-binders
- Preparation of wide band gap monomers and silafluorene copolymers with blue electroluminescence, as emitter layer in organic LEDs
- Asymmetric synthesis of gamma-nitrophosphonates via Michael addition with nitroalkenes
- Wittig-Horner reactions
| | reaction suitability | reaction type: C-C Bond Formation |
| | Diethyl 4-chlorobenzylphosphonate Preparation Products And Raw materials |
|