| Company Name: |
Roark Standards |
| Tel: |
0755-83552066 15986688328 |
| Email: |
service@roarkstandards.com |
- 2-Bromo Diclofenac
-
-
2026-06-30
- CAS:127792-23-8
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10000KGS
|
| | 2-Bromo Diclofenac Basic information |
| Product Name: | 2-Bromo Diclofenac | | Synonyms: | Diclofenac Impurity 1(Diclofenac EP Impurity D);Diclofenac impurity 3/Diclofenac EP Impurity D/2-[2-[(2-Bromo-6-chlorophenyl) amino]phenyl] acetic acid;2-[2-[(2-Bromo-6-chlorophenyl)amino;Benzeneacetic acid, 2-[(2-bromo-6-chlorophenyl)amino]-;Diclofenac Impurity 1（EP-D）;2-[2-(2-bromo-6-chloroanilino)phenyl]aceticacid;2-[(2-Bromo-6-chlorophenyl)amino]benzeneacetic acid;Diclofenac Sodium EP Impurity D | | CAS: | 127792-23-8 | | MF: | C14H11BrClNO2 | | MW: | 340.6 | | EINECS: | | | Product Categories: | | | Mol File: | 127792-23-8.mol |  |
| | 2-Bromo Diclofenac Chemical Properties |
| Boiling point | 427.0±45.0 °C(Predicted) | | density | 1.613±0.06 g/cm3(Predicted) | | pka | 4.18±0.10(Predicted) | | form | powder | | Major Application | pharmaceutical | | InChI | 1S/C14H11BrClNO2/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19/h1-7,17H,8H2,(H,18,19) | | InChIKey | RABKUCPRNJPBRH-UHFFFAOYSA-N | | SMILES | Brc1c(c(ccc1)Cl)Nc2c(cccc2)CC(=O)O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 2
Repr. 2
STOT RE 2 |
| | 2-Bromo Diclofenac Usage And Synthesis |
| | 2-Bromo Diclofenac Preparation Products And Raw materials |
|