| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | FMOC-MET(O)-OH Basic information |
| Product Name: | FMOC-MET(O)-OH | | Synonyms: | FMOC-METHIONINE(O)-OH;FMOC-L-METHIONINE-DL-SULFOXIDE;FMOC-L-METHIONINE SULFOXIDE;FMOC-L-MET(O)-OH;FMOC-MET(O)-OH;N-ALPHA-FMOC-L-METHIONINE-DL-SULFOXIDE;(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-4-methanesulfinylbutanoic acid;N-ALPHA-FMOC-L-METHIONINE-SULFOXIDE | | CAS: | 76265-70-8 | | MF: | C20H21NO5S | | MW: | 387.45 | | EINECS: | | | Product Categories: | | | Mol File: | 76265-70-8.mol |  |
| | FMOC-MET(O)-OH Chemical Properties |
| Boiling point | 698.0±55.0 °C(Predicted) | | density | 1.358±0.06 g/cm3(Predicted) | | storage temp. | Store below +30°C. | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 3.59±0.10(Predicted) | | form | Powder | | color | White | | Major Application | peptide synthesis | | InChI | 1S/C20H21NO5S/c1-27(25)11-10-18(19(22)23)21-20(24)26-12-17-15-8-4-2-6-13(15)14-7-3-5-9-16(14)17/h2-9,17-18H,10-12H2,1H3,(H,21,24)(H,22,23)/t18-,27/m0/s1 | | InChIKey | CEHRSUBRZOGRSW-HSYKDVHTSA-N | | SMILES | [S](=O)(CC[C@H](NC(=O)OCC1c2c(cccc2)c3c1cccc3)C(=O)O)C | | CAS DataBase Reference | 76265-70-8(CAS DataBase Reference) |
| WGK Germany | WGK 2 water endangering | | HS Code | 2930 90 98 | | Storage Class | 11 - Combustible Solids |
| | FMOC-MET(O)-OH Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | Fmoc-Met(O)-OH Novabiochem(R). CAS 76265-70-8, molar mass 387.45 g/mol. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-MET(O)-OH Preparation Products And Raw materials |
|