| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Methyl-2-(methylsulfanyl)pyrimidine Basic information |
| | 4-Methyl-2-(methylsulfanyl)pyrimidine Chemical Properties |
| Boiling point | 78-80°/1mm | | density | 1.007 g/mL at 25 °C | | refractive index | n20/D 1.572 | | Fp | 220 °F | | storage temp. | 2-8°C | | form | liquid | | pka | 1.35±0.20(Predicted) | | color | Dark brown | | InChI | InChI=1S/C6H8N2S/c1-5-3-4-7-6(8-5)9-2/h3-4H,1-2H3 | | InChIKey | UCERVHYBSTYCQS-UHFFFAOYSA-N | | SMILES | C1(SC)=NC=CC(C)=N1 |
| Hazard Codes | Xn | | Risk Statements | 22-37/38-41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29335990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | 4-Methyl-2-(methylsulfanyl)pyrimidine Usage And Synthesis |
| Chemical Properties | Colorless to yellow to red liquid | | Uses | 4-Methyl-2-(methylthio)pyrimidine is used as a reagent to prepare pyrazolopyrimidines and pyrazolotriazines, both of which display potent activity against herpes viruses. 4-Methyl-2-(methylthio)pyrimidine is also used as a starting material to synthesize 4-substituted-2-aminopyrimidines (e.g. 2-amino-4-ethylpyridine [A609500]), novel c-Jun N-terminal kinase (JNK) inhibitors. | | Synthesis | To an aqueous (120 mL) solution of NaOH (7.46 g, 186.4 mmol) under argon atmosphere,
4-methylpyrimidine-2-thiolate (13.78 g, 84.7 mmol) was added, followed by the dropwise addition of
into iodomethane (13.23 g, 93.2 mmol). The solution was stirred at room temperature for 2 hours and then CH2Cl2(2x) was used to
Extraction. The organic phase was dried over Na2SO4 and concentrated to dryness. The crude product obtained was purified by silica gel chromatography using a hexane-EtOAc mixture of increased polarity as eluent to yield
10.26 g of the desired compound (yield: 86%). |
| | 4-Methyl-2-(methylsulfanyl)pyrimidine Preparation Products And Raw materials |
|