| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | ROSE BENGAL LACTONE Basic information |
| Product Name: | ROSE BENGAL LACTONE | | Synonyms: | 4’,5’,7’-tetraiodo-droxy-2;spiro[isobenzofuran-1(3h),9’-[9h]xanthen]-3-one,4,5,6,7-tetrachloro-3’,6’-dihy;ROSE BENGAL LACTONE;4,5,6,7-tetrachloro-3',6'-dihydroxy-2',4',5',7'-tetraiodospiro[isobenzofuran-1(3H),9'-[9H]xanthene]-3-one;2,4,5,7-Tetraiodo-3,6-dihydroxy-4',5',6',7'-tetrachlorospiro[9H-xanthene-9,1'(3'H)-isobenzofuran]-3'-one;3,6-Dihydroxy-2,4,5,7-tetraiodo-4',5',6',7'-tetrachlorospiro[9H-xanthene-9,1'(3'H)-isobenzofuran]-3'-one;4',5',6',7'-Tetrachloro-3,6-dihydroxy-2,4,5,7-tetraiodospiro[9H-xanthene-9,1'(3'H)-isobenzofuran]-3'-one;Solvent Red 141 | | CAS: | 4159-77-7 | | MF: | C20H4Cl4I4O5 | | MW: | 973.67 | | EINECS: | 223-993-4 | | Product Categories: | Q-R;Stains and Dyes;Stains&Dyes, A to | | Mol File: | 4159-77-7.mol |  |
| | ROSE BENGAL LACTONE Chemical Properties |
| Melting point | 280 °C (dec.)(lit.) | | storage temp. | room temp | | Boiling point | 741.8±60.0 °C(Predicted) | | density | 2.96±0.1 g/cm3(Predicted) | | pKa | 7.03±0.20(Predicted) | | form | powder | | color | pink to red | | λmax | 557 nm | | ε(extinction coefficient) | ≥10000 at 317-323nm
≥30000 at 516-522nm
≥95000 at 554-560nm | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | 1S/C20H4Cl4I4O5/c21-9-7-8(10(22)12(24)11(9)23)20(33-19(7)31)3-1-5(25)15(29)13(27)17(3)32-18-4(20)2-6(26)16(30)14(18)28/h1-2,29-30H | | InChIKey | IICCLYANAQEHCI-UHFFFAOYSA-N | | SMILES | Oc1c(I)cc2c(Oc3c(I)c(O)c(I)cc3C24OC(=O)c5c(Cl)c(Cl)c(Cl)c(Cl)c45)c1I | | EPA Substance Registry System | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 4,5,6,7-tetrachloro-3',6'-dihydroxy-2',4',5',7'-tetraiodo- (4159-77-7) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | ROSE BENGAL LACTONE Usage And Synthesis |
| Description | Rose bengal lactone is a potent inhibitor of human metabolism that binds to the proteasome pathway and inhibits the polymerization of tubulin. It has been shown to bind with high affinity to microtubules and inhibit their assembly, which leads to cell death. Rose bengal lactone also binds with high affinity to potassium ion, which may contribute to its anti-cancer effects. This compound has also been found to be an effective inhibitor of goiters in rats by binding with aliphatic hydrocarbons such as cholesterol. | | Chemical Properties | Bluish-pink powder. Soluble in water. | | Uses | Biological stain; colorant for inks, cellulosics,
foods, cosmetics, medicine (diagnostic aid). | | Preparation | will Resorcinol and 4,5,6,7-Tetrachloroisobenzofuran-1,3-dione condensation, The resulting 4,5,6,7 – tetrachloro-fluorescein tetraiodide. | | Properties and Applications | blue light red. Soluble in water for blue light yellow, no fluorescence, in concentrated sulfuric acid for brown, dilution after hot pink precipitation. Used in cosmetics coloring.
|
Standard
|
Light Fastness
|
Heat-resistant(℃)
|
water
|
Sodium Carbonate(5%)
|
Hydrochloric acid(5%)
|
|
Melting point
|
Stable
|
|
ISO
|
Poor
|
|
|
Insoluble
|
|
|
|
| | ROSE BENGAL LACTONE Preparation Products And Raw materials |
|