|
|
| | N,N'-ETHYLENEBISOLEAMIDE Basic information |
| Product Name: | N,N'-ETHYLENEBISOLEAMIDE | | Synonyms: | N,N'-ETHYLENEBISOLEAMIDE;n,n’-1,2-ethanediylbis-,(z,z)-9-octadecenamid;N,N’-1,2-ethanediylbis-,(Z,Z)-9-Octadecenamide;N,N’-1,2-Ethamediyl Bis-9-Octadecenamide;(9Z,9'Z)-N,N'-1,2-Ethanediylbis[9-octadecenamide];n,n’-ethane-1,;n,n’-ethane-1,2-diylbisoleamide;Glycolube(R) VL | | CAS: | 110-31-6 | | MF: | C38H72N2O2 | | MW: | 588.99 | | EINECS: | 203-756-1 | | Product Categories: | | | Mol File: | 110-31-6.mol |  |
| | N,N'-ETHYLENEBISOLEAMIDE Chemical Properties |
| Melting point | 115-118 °C(lit.) | | Boiling point | 728.5±60.0 °C(Predicted) | | density | 0.899±0.06 g/cm3(Predicted) | | vapor pressure | 0.03Pa at 25℃ | | storage temp. | 2-8°C | | pka | 15.52±0.46(Predicted) | | Cosmetics Ingredients Functions | VISCOSITY CONTROLLING | | InChIKey | OXDXXMDEEFOVHR-CLFAGFIQSA-N | | SMILES | C(NC(=O)CCCCCCC/C=C\CCCCCCCC)CNC(=O)CCCCCCC/C=C\CCCCCCCC | | LogP | 13.958 (est) | | EPA Substance Registry System | 9-Octadecenamide, N,N'-1,2-ethanediylbis-, (9Z,9'Z)- (110-31-6) |
| | N,N'-ETHYLENEBISOLEAMIDE Usage And Synthesis |
| Chemical Properties | Beads | | Uses | N,N'-Ethylenebisoleamide is used as an internal and external lubricant for thermoplastics, as a mold release agent with TPU and as an anti-block and slip agent in printing ink vehicles. | | Flammability and Explosibility | Non flammable |
| | N,N'-ETHYLENEBISOLEAMIDE Preparation Products And Raw materials |
|